C7H10N2 — CID 22913067
4-methyl-1,2,3,6-tetrahydropyridine-3-carbonitrile (PubChem CID 22913067) has the molecular formula C7H10N2 and a molecular weight of 122.17 g/mol. Its IUPAC name is 4-methyl-1,2,3,6-tetrahydropyridine-3-carbonitrile.
| Compound Name | 4-methyl-1,2,3,6-tetrahydropyridine-3-carbonitrile |
|---|---|
| PubChem CID | 22913067 |
| Molecular Formula | C7H10N2 |
| Molecular Weight | 122.17 g/mol |
| Exact Mass | 122.08 |
| IUPAC Name | 4-methyl-1,2,3,6-tetrahydropyridine-3-carbonitrile |
| SMILES | CC1=CCNCC1C#N |
| InChI | InChI=1S/C7H10N2/c1-6-2-3-9-5-7(6)4-8/h2,7,9H,3,5H2,1H3 |
| InChIKey | LIMVJQPLNAENJI-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 122.17 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|