C31H37F3N2O4 — CID 22913209
[1,1,1-trifluoro-3-[2-[4-(4-pentylphenyl)phenyl]pyrimidin-5-yl]oxypropan-2-yl] 2-butoxypropanoate (PubChem CID 22913209) has the molecular formula C31H37F3N2O4 and a molecular weight of 558.64 g/mol. Its IUPAC name is [1,1,1-trifluoro-3-[2-[4-(4-pentylphenyl)phenyl]pyrimidin-5-yl]oxypropan-2-yl] 2-butoxypropanoate.
| Compound Name | [1,1,1-trifluoro-3-[2-[4-(4-pentylphenyl)phenyl]pyrimidin-5-yl]oxypropan-2-yl] 2-butoxypropanoate |
|---|---|
| PubChem CID | 22913209 |
| Molecular Formula | C31H37F3N2O4 |
| Molecular Weight | 558.64 g/mol |
| Exact Mass | 558.27 |
| IUPAC Name | [1,1,1-trifluoro-3-[2-[4-(4-pentylphenyl)phenyl]pyrimidin-5-yl]oxypropan-2-yl] 2-butoxypropanoate |
| SMILES | CCCCCc1ccc(-c2ccc(-c3ncc(OCC(OC(=O)C(C)OCCCC)C(F)(F)F)cn3)cc2)cc1 |
| InChI | InChI=1S/C31H37F3N2O4/c1-4-6-8-9-23-10-12-24(13-11-23)25-14-16-26(17-15-25)29-35-19-27(20-36-29)39-21-28(31(32,33)34)40-30(37)22(3)38-18-7-5-2/h10-17,19-20,22,28H,4-9,18,21H2,1-3H3 |
| InChIKey | RYUSVFCUZVIYGF-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 70.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.64 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|