C32H39F3N2O4 — CID 22913229
[1,1,1-trifluoro-3-[2-[4-(4-hexylphenyl)phenyl]pyrimidin-5-yl]oxypropan-2-yl] 2-butoxypropanoate (PubChem CID 22913229) has the molecular formula C32H39F3N2O4 and a molecular weight of 572.67 g/mol. Its IUPAC name is [1,1,1-trifluoro-3-[2-[4-(4-hexylphenyl)phenyl]pyrimidin-5-yl]oxypropan-2-yl] 2-butoxypropanoate.
| Compound Name | [1,1,1-trifluoro-3-[2-[4-(4-hexylphenyl)phenyl]pyrimidin-5-yl]oxypropan-2-yl] 2-butoxypropanoate |
|---|---|
| PubChem CID | 22913229 |
| Molecular Formula | C32H39F3N2O4 |
| Molecular Weight | 572.67 g/mol |
| Exact Mass | 572.29 |
| IUPAC Name | [1,1,1-trifluoro-3-[2-[4-(4-hexylphenyl)phenyl]pyrimidin-5-yl]oxypropan-2-yl] 2-butoxypropanoate |
| SMILES | CCCCCCc1ccc(-c2ccc(-c3ncc(OCC(OC(=O)C(C)OCCCC)C(F)(F)F)cn3)cc2)cc1 |
| InChI | InChI=1S/C32H39F3N2O4/c1-4-6-8-9-10-24-11-13-25(14-12-24)26-15-17-27(18-16-26)30-36-20-28(21-37-30)40-22-29(32(33,34)35)41-31(38)23(3)39-19-7-5-2/h11-18,20-21,23,29H,4-10,19,22H2,1-3H3 |
| InChIKey | MRRYRHQFKQUCSO-UHFFFAOYSA-N |
| XLogP | 7.99 |
| TPSA | 70.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.67 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|