C31H34F3NO4 — CID 22913248
(1,1,1-trifluoro-3-oxo-3-propoxypropan-2-yl) 4-[6-(4-heptylphenyl)-3-pyridinyl]benzoate (PubChem CID 22913248) has the molecular formula C31H34F3NO4 and a molecular weight of 541.61 g/mol. Its IUPAC name is (1,1,1-trifluoro-3-oxo-3-propoxypropan-2-yl) 4-[6-(4-heptylphenyl)-3-pyridinyl]benzoate.
| Compound Name | (1,1,1-trifluoro-3-oxo-3-propoxypropan-2-yl) 4-[6-(4-heptylphenyl)-3-pyridinyl]benzoate |
|---|---|
| PubChem CID | 22913248 |
| Molecular Formula | C31H34F3NO4 |
| Molecular Weight | 541.61 g/mol |
| Exact Mass | 541.24 |
| IUPAC Name | (1,1,1-trifluoro-3-oxo-3-propoxypropan-2-yl) 4-[6-(4-heptylphenyl)-3-pyridinyl]benzoate |
| SMILES | CCCCCCCc1ccc(-c2ccc(-c3ccc(C(=O)OC(C(=O)OCCC)C(F)(F)F)cc3)cn2)cc1 |
| InChI | InChI=1S/C31H34F3NO4/c1-3-5-6-7-8-9-22-10-12-24(13-11-22)27-19-18-26(21-35-27)23-14-16-25(17-15-23)29(36)39-28(31(32,33)34)30(37)38-20-4-2/h10-19,21,28H,3-9,20H2,1-2H3 |
| InChIKey | FEFMGVNCBAUIIG-UHFFFAOYSA-N |
| XLogP | 7.97 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.61 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|