C34H41F3N2O5 — CID 22913286
[4-(1,1,1-trifluoro-3-propoxypropan-2-yl)oxycarbonylphenyl] 4-(5-decylpyrimidin-2-yl)benzoate (PubChem CID 22913286) has the molecular formula C34H41F3N2O5 and a molecular weight of 614.71 g/mol. Its IUPAC name is [4-(1,1,1-trifluoro-3-propoxypropan-2-yl)oxycarbonylphenyl] 4-(5-decylpyrimidin-2-yl)benzoate.
| Compound Name | [4-(1,1,1-trifluoro-3-propoxypropan-2-yl)oxycarbonylphenyl] 4-(5-decylpyrimidin-2-yl)benzoate |
|---|---|
| PubChem CID | 22913286 |
| Molecular Formula | C34H41F3N2O5 |
| Molecular Weight | 614.71 g/mol |
| Exact Mass | 614.30 |
| IUPAC Name | [4-(1,1,1-trifluoro-3-propoxypropan-2-yl)oxycarbonylphenyl] 4-(5-decylpyrimidin-2-yl)benzoate |
| SMILES | CCCCCCCCCCc1cnc(-c2ccc(C(=O)Oc3ccc(C(=O)OC(COCCC)C(F)(F)F)cc3)cc2)nc1 |
| InChI | InChI=1S/C34H41F3N2O5/c1-3-5-6-7-8-9-10-11-12-25-22-38-31(39-23-25)26-13-15-27(16-14-26)32(40)43-29-19-17-28(18-20-29)33(41)44-30(34(35,36)37)24-42-21-4-2/h13-20,22-23,30H,3-12,21,24H2,1-2H3 |
| InChIKey | ZMGLIOQCWVZWGA-UHFFFAOYSA-N |
| XLogP | 8.56 |
| TPSA | 87.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.71 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|