About [1,1,1-trifluoro-3-[2-[4-(4-heptylphenyl)phenyl]pyrimidin-5-yl]oxypropan-2-yl] butanoate
[1,1,1-trifluoro-3-[2-[4-(4-heptylphenyl)phenyl]pyrimidin-5-yl]oxypropan-2-yl] butanoate (PubChem CID 22913331) has the molecular formula C30H35F3N2O3
and a molecular weight of 528.62 g/mol. Its IUPAC name is [1,1,1-trifluoro-3-[2-[4-(4-heptylphenyl)phenyl]pyrimidin-5-yl]oxypropan-2-yl] butanoate.
Molecular Properties
| Compound Name | [1,1,1-trifluoro-3-[2-[4-(4-heptylphenyl)phenyl]pyrimidin-5-yl]oxypropan-2-yl] butanoate |
| PubChem CID | 22913331 |
| Molecular Formula | C30H35F3N2O3 |
| Molecular Weight | 528.62 g/mol |
| Exact Mass | 528.26 |
| IUPAC Name | [1,1,1-trifluoro-3-[2-[4-(4-heptylphenyl)phenyl]pyrimidin-5-yl]oxypropan-2-yl] butanoate |
| SMILES | CCCCCCCc1ccc(-c2ccc(-c3ncc(OCC(OC(=O)CCC)C(F)(F)F)cn3)cc2)cc1 |
| InChI | InChI=1S/C30H35F3N2O3/c1-3-5-6-7-8-10-22-11-13-23(14-12-22)24-15-17-25(18-16-24)29-34-19-26(20-35-29)37-21-27(30(31,32)33)38-28(36)9-4-2/h11-20,27H,3-10,21H2,1-2H3 |
| InChIKey | MDNBRCUBORFZGJ-UHFFFAOYSA-N |
| XLogP | 7.98 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 528.62 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [1,1,1-trifluoro-3-[2-[4-(4-heptylphenyl)phenyl]pyrimidin-5-yl]oxypropan-2-yl] butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1,1,1-trifluoro-3-[2-[4-(4-heptylphenyl)phenyl]pyrimidin-5-yl]oxypropan-2-yl] butanoate?
The IUPAC name of [1,1,1-trifluoro-3-[2-[4-(4-heptylphenyl)phenyl]pyrimidin-5-yl]oxypropan-2-yl] butanoate (CID 22913331) is [1,1,1-trifluoro-3-[2-[4-(4-heptylphenyl)phenyl]pyrimidin-5-yl]oxypropan-2-yl] butanoate.
What is the SMILES notation for [1,1,1-trifluoro-3-[2-[4-(4-heptylphenyl)phenyl]pyrimidin-5-yl]oxypropan-2-yl] butanoate?
The canonical SMILES for [1,1,1-trifluoro-3-[2-[4-(4-heptylphenyl)phenyl]pyrimidin-5-yl]oxypropan-2-yl] butanoate is CCCCCCCc1ccc(-c2ccc(-c3ncc(OCC(OC(=O)CCC)C(F)(F)F)cn3)cc2)cc1.
What is the InChIKey of [1,1,1-trifluoro-3-[2-[4-(4-heptylphenyl)phenyl]pyrimidin-5-yl]oxypropan-2-yl] butanoate?
The InChIKey is MDNBRCUBORFZGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H35F3N2O3/c1-3-5-6-7-8-10-22-11-13-23(14-12-22)24-15-17-25(18-16-24)29-34-19-26(20-35-29)37-21-27(30(31,32)33)38-28(36)9-4-2/h11-20,27H,3-10,21H2,1-2H3.
What are the key properties of [1,1,1-trifluoro-3-[2-[4-(4-heptylphenyl)phenyl]pyrimidin-5-yl]oxypropan-2-yl] butanoate?
[1,1,1-trifluoro-3-[2-[4-(4-heptylphenyl)phenyl]pyrimidin-5-yl]oxypropan-2-yl] butanoate has a molecular weight of 528.62 g/mol, XLogP of 7.98, 14 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1,1,1-trifluoro-3-[2-[4-(4-heptylphenyl)phenyl]pyrimidin-5-yl]oxypropan-2-yl] butanoate is sourced from PubChem (CID 22913331), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).