C31H35F3N2O5 — CID 22913357
[4-(1,1,1-trifluoro-3-propoxypropan-2-yl)oxycarbonylphenyl] 4-(5-heptylpyrimidin-2-yl)benzoate (PubChem CID 22913357) has the molecular formula C31H35F3N2O5 and a molecular weight of 572.62 g/mol. Its IUPAC name is [4-(1,1,1-trifluoro-3-propoxypropan-2-yl)oxycarbonylphenyl] 4-(5-heptylpyrimidin-2-yl)benzoate.
| Compound Name | [4-(1,1,1-trifluoro-3-propoxypropan-2-yl)oxycarbonylphenyl] 4-(5-heptylpyrimidin-2-yl)benzoate |
|---|---|
| PubChem CID | 22913357 |
| Molecular Formula | C31H35F3N2O5 |
| Molecular Weight | 572.62 g/mol |
| Exact Mass | 572.25 |
| IUPAC Name | [4-(1,1,1-trifluoro-3-propoxypropan-2-yl)oxycarbonylphenyl] 4-(5-heptylpyrimidin-2-yl)benzoate |
| SMILES | CCCCCCCc1cnc(-c2ccc(C(=O)Oc3ccc(C(=O)OC(COCCC)C(F)(F)F)cc3)cc2)nc1 |
| InChI | InChI=1S/C31H35F3N2O5/c1-3-5-6-7-8-9-22-19-35-28(36-20-22)23-10-12-24(13-11-23)29(37)40-26-16-14-25(15-17-26)30(38)41-27(31(32,33)34)21-39-18-4-2/h10-17,19-20,27H,3-9,18,21H2,1-2H3 |
| InChIKey | WUVZULZKFODQKE-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 87.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.62 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|