About (3-ethoxy-1,1,1-trifluoropropan-2-yl) 4-(5-hexyl-2-pyridinyl)benzoate
(3-ethoxy-1,1,1-trifluoropropan-2-yl) 4-(5-hexyl-2-pyridinyl)benzoate (PubChem CID 22913375) has the molecular formula C23H28F3NO3
and a molecular weight of 423.48 g/mol. Its IUPAC name is (3-ethoxy-1,1,1-trifluoropropan-2-yl) 4-(5-hexyl-2-pyridinyl)benzoate.
Molecular Properties
| Compound Name | (3-ethoxy-1,1,1-trifluoropropan-2-yl) 4-(5-hexyl-2-pyridinyl)benzoate |
| PubChem CID | 22913375 |
| Molecular Formula | C23H28F3NO3 |
| Molecular Weight | 423.48 g/mol |
| Exact Mass | 423.20 |
| IUPAC Name | (3-ethoxy-1,1,1-trifluoropropan-2-yl) 4-(5-hexyl-2-pyridinyl)benzoate |
| SMILES | CCCCCCc1ccc(-c2ccc(C(=O)OC(COCC)C(F)(F)F)cc2)nc1 |
| InChI | InChI=1S/C23H28F3NO3/c1-3-5-6-7-8-17-9-14-20(27-15-17)18-10-12-19(13-11-18)22(28)30-21(16-29-4-2)23(24,25)26/h9-15,21H,3-8,16H2,1-2H3 |
| InChIKey | NQZDLAXKJCTFDQ-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 423.48 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (3-ethoxy-1,1,1-trifluoropropan-2-yl) 4-(5-hexyl-2-pyridinyl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-ethoxy-1,1,1-trifluoropropan-2-yl) 4-(5-hexyl-2-pyridinyl)benzoate?
The IUPAC name of (3-ethoxy-1,1,1-trifluoropropan-2-yl) 4-(5-hexyl-2-pyridinyl)benzoate (CID 22913375) is (3-ethoxy-1,1,1-trifluoropropan-2-yl) 4-(5-hexyl-2-pyridinyl)benzoate.
What is the SMILES notation for (3-ethoxy-1,1,1-trifluoropropan-2-yl) 4-(5-hexyl-2-pyridinyl)benzoate?
The canonical SMILES for (3-ethoxy-1,1,1-trifluoropropan-2-yl) 4-(5-hexyl-2-pyridinyl)benzoate is CCCCCCc1ccc(-c2ccc(C(=O)OC(COCC)C(F)(F)F)cc2)nc1.
What is the InChIKey of (3-ethoxy-1,1,1-trifluoropropan-2-yl) 4-(5-hexyl-2-pyridinyl)benzoate?
The InChIKey is NQZDLAXKJCTFDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H28F3NO3/c1-3-5-6-7-8-17-9-14-20(27-15-17)18-10-12-19(13-11-18)22(28)30-21(16-29-4-2)23(24,25)26/h9-15,21H,3-8,16H2,1-2H3.
What are the key properties of (3-ethoxy-1,1,1-trifluoropropan-2-yl) 4-(5-hexyl-2-pyridinyl)benzoate?
(3-ethoxy-1,1,1-trifluoropropan-2-yl) 4-(5-hexyl-2-pyridinyl)benzoate has a molecular weight of 423.48 g/mol, XLogP of 6.00, 11 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-ethoxy-1,1,1-trifluoropropan-2-yl) 4-(5-hexyl-2-pyridinyl)benzoate is sourced from PubChem (CID 22913375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).