About 2-(2-bromoethyl)-5-ethoxy-5,6-difluorocyclohexa-1,3-diene
2-(2-bromoethyl)-5-ethoxy-5,6-difluorocyclohexa-1,3-diene (PubChem CID 22913619) has the molecular formula C10H13BrF2O
and a molecular weight of 267.11 g/mol. Its IUPAC name is 2-(2-bromoethyl)-5-ethoxy-5,6-difluorocyclohexa-1,3-diene.
Molecular Properties
| Compound Name | 2-(2-bromoethyl)-5-ethoxy-5,6-difluorocyclohexa-1,3-diene |
| PubChem CID | 22913619 |
| Molecular Formula | C10H13BrF2O |
| Molecular Weight | 267.11 g/mol |
| Exact Mass | 266.01 |
| IUPAC Name | 2-(2-bromoethyl)-5-ethoxy-5,6-difluorocyclohexa-1,3-diene |
| SMILES | CCOC1(F)C=CC(CCBr)=CC1F |
| InChI | InChI=1S/C10H13BrF2O/c1-2-14-10(13)5-3-8(4-6-11)7-9(10)12/h3,5,7,9H,2,4,6H2,1H3 |
| InChIKey | LYCKAJBWOFYHSL-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.11 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-bromoethyl)-5-ethoxy-5,6-difluorocyclohexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-bromoethyl)-5-ethoxy-5,6-difluorocyclohexa-1,3-diene?
The IUPAC name of 2-(2-bromoethyl)-5-ethoxy-5,6-difluorocyclohexa-1,3-diene (CID 22913619) is 2-(2-bromoethyl)-5-ethoxy-5,6-difluorocyclohexa-1,3-diene.
What is the SMILES notation for 2-(2-bromoethyl)-5-ethoxy-5,6-difluorocyclohexa-1,3-diene?
The canonical SMILES for 2-(2-bromoethyl)-5-ethoxy-5,6-difluorocyclohexa-1,3-diene is CCOC1(F)C=CC(CCBr)=CC1F.
What is the InChIKey of 2-(2-bromoethyl)-5-ethoxy-5,6-difluorocyclohexa-1,3-diene?
The InChIKey is LYCKAJBWOFYHSL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13BrF2O/c1-2-14-10(13)5-3-8(4-6-11)7-9(10)12/h3,5,7,9H,2,4,6H2,1H3.
What are the key properties of 2-(2-bromoethyl)-5-ethoxy-5,6-difluorocyclohexa-1,3-diene?
2-(2-bromoethyl)-5-ethoxy-5,6-difluorocyclohexa-1,3-diene has a molecular weight of 267.11 g/mol, XLogP of 3.31, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-bromoethyl)-5-ethoxy-5,6-difluorocyclohexa-1,3-diene is sourced from PubChem (CID 22913619), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).