About CID 22913647
CID 22913647 (PubChem CID 22913647) has the molecular formula C17H33BrSi2
and a molecular weight of 373.53 g/mol.
Molecular Properties
| Compound Name | CID 22913647 |
| PubChem CID | 22913647 |
| Molecular Formula | C17H33BrSi2 |
| Molecular Weight | 373.53 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | — |
| SMILES | CCCCC[Si]1CCC([Si]2CCC(CCBr)CC2)CC1 |
| InChI | InChI=1S/C17H33BrSi2/c1-2-3-4-11-19-12-8-17(9-13-19)20-14-6-16(5-10-18)7-15-20/h16-17H,2-15H2,1H3 |
| InChIKey | YUDGCNKOGPLBAH-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 373.53 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 22913647 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 22913647?
The IUPAC name of CID 22913647 (CID 22913647) is not available.
What is the SMILES notation for CID 22913647?
The canonical SMILES for CID 22913647 is CCCCC[Si]1CCC([Si]2CCC(CCBr)CC2)CC1.
What is the InChIKey of CID 22913647?
The InChIKey is YUDGCNKOGPLBAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H33BrSi2/c1-2-3-4-11-19-12-8-17(9-13-19)20-14-6-16(5-10-18)7-15-20/h16-17H,2-15H2,1H3.
What are the key properties of CID 22913647?
CID 22913647 has a molecular weight of 373.53 g/mol, XLogP of 6.53, 7 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 22913647 is sourced from PubChem (CID 22913647), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).