C14H26O — CID 22914098
2,5-dimethyl-3-(2,2,3-trimethylcyclopentyl)oxolane (PubChem CID 22914098) has the molecular formula C14H26O and a molecular weight of 210.36 g/mol. Its IUPAC name is 2,5-dimethyl-3-(2,2,3-trimethylcyclopentyl)oxolane.
| Compound Name | 2,5-dimethyl-3-(2,2,3-trimethylcyclopentyl)oxolane |
|---|---|
| PubChem CID | 22914098 |
| Molecular Formula | C14H26O |
| Molecular Weight | 210.36 g/mol |
| Exact Mass | 210.20 |
| IUPAC Name | 2,5-dimethyl-3-(2,2,3-trimethylcyclopentyl)oxolane |
| SMILES | CC1CC(C2CCC(C)C2(C)C)C(C)O1 |
| InChI | InChI=1S/C14H26O/c1-9-6-7-13(14(9,4)5)12-8-10(2)15-11(12)3/h9-13H,6-8H2,1-5H3 |
| InChIKey | DXXWPZPHLNAZQN-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.36 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |