C11H8N4OS — CID 22914311
8-methyl-7-oxo-5-thia-1,8,12-triazatricyclo[8.3.0.02,6]trideca-2(6),3,10,12-tetraene-11-carbonitrile (PubChem CID 22914311) has the molecular formula C11H8N4OS and a molecular weight of 244.28 g/mol. Its IUPAC name is 8-methyl-7-oxo-5-thia-1,8,12-triazatricyclo[8.3.0.02,6]trideca-2(6),3,10,12-tetraene-11-carbonitrile.
| Compound Name | 8-methyl-7-oxo-5-thia-1,8,12-triazatricyclo[8.3.0.02,6]trideca-2(6),3,10,12-tetraene-11-carbonitrile |
|---|---|
| PubChem CID | 22914311 |
| Molecular Formula | C11H8N4OS |
| Molecular Weight | 244.28 g/mol |
| Exact Mass | 244.04 |
| IUPAC Name | 8-methyl-7-oxo-5-thia-1,8,12-triazatricyclo[8.3.0.02,6]trideca-2(6),3,10,12-tetraene-11-carbonitrile |
| SMILES | CN1Cc2c(C#N)ncn2-c2ccsc2C1=O |
| InChI | InChI=1S/C11H8N4OS/c1-14-5-9-7(4-12)13-6-15(9)8-2-3-17-10(8)11(14)16/h2-3,6H,5H2,1H3 |
| InChIKey | ZPUHVIQUBFBAGT-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 61.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.28 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |