About 4-piperidin-4-yl-1,4-benzothiazin-3-one;hydrochloride
4-piperidin-4-yl-1,4-benzothiazin-3-one;hydrochloride (PubChem CID 22914728) has the molecular formula C13H17ClN2OS
and a molecular weight of 284.81 g/mol. Its IUPAC name is 4-piperidin-4-yl-1,4-benzothiazin-3-one;hydrochloride.
Molecular Properties
| Compound Name | 4-piperidin-4-yl-1,4-benzothiazin-3-one;hydrochloride |
| PubChem CID | 22914728 |
| Molecular Formula | C13H17ClN2OS |
| Molecular Weight | 284.81 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | 4-piperidin-4-yl-1,4-benzothiazin-3-one;hydrochloride |
| SMILES | Cl.O=C1CSc2ccccc2N1C1CCNCC1 |
| InChI | InChI=1S/C13H16N2OS.ClH/c16-13-9-17-12-4-2-1-3-11(12)15(13)10-5-7-14-8-6-10;/h1-4,10,14H,5-9H2;1H |
| InChIKey | HBHXPKKCCATHRZ-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.81 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-piperidin-4-yl-1,4-benzothiazin-3-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-piperidin-4-yl-1,4-benzothiazin-3-one;hydrochloride?
The IUPAC name of 4-piperidin-4-yl-1,4-benzothiazin-3-one;hydrochloride (CID 22914728) is 4-piperidin-4-yl-1,4-benzothiazin-3-one;hydrochloride.
What is the SMILES notation for 4-piperidin-4-yl-1,4-benzothiazin-3-one;hydrochloride?
The canonical SMILES for 4-piperidin-4-yl-1,4-benzothiazin-3-one;hydrochloride is Cl.O=C1CSc2ccccc2N1C1CCNCC1.
What is the InChIKey of 4-piperidin-4-yl-1,4-benzothiazin-3-one;hydrochloride?
The InChIKey is HBHXPKKCCATHRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N2OS.ClH/c16-13-9-17-12-4-2-1-3-11(12)15(13)10-5-7-14-8-6-10;/h1-4,10,14H,5-9H2;1H.
What are the key properties of 4-piperidin-4-yl-1,4-benzothiazin-3-one;hydrochloride?
4-piperidin-4-yl-1,4-benzothiazin-3-one;hydrochloride has a molecular weight of 284.81 g/mol, XLogP of 2.30, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-piperidin-4-yl-1,4-benzothiazin-3-one;hydrochloride is sourced from PubChem (CID 22914728), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).