About 3-(diaminomethylidene)-1,2-dimethyl-1-prop-2-enylguanidine
3-(diaminomethylidene)-1,2-dimethyl-1-prop-2-enylguanidine (PubChem CID 22915573) has the molecular formula C7H15N5
and a molecular weight of 169.23 g/mol. Its IUPAC name is 3-(diaminomethylidene)-1,2-dimethyl-1-prop-2-enylguanidine.
Molecular Properties
| Compound Name | 3-(diaminomethylidene)-1,2-dimethyl-1-prop-2-enylguanidine |
| PubChem CID | 22915573 |
| Molecular Formula | C7H15N5 |
| Molecular Weight | 169.23 g/mol |
| Exact Mass | 169.13 |
| IUPAC Name | 3-(diaminomethylidene)-1,2-dimethyl-1-prop-2-enylguanidine |
| SMILES | C=CCN(C)/C(N=C(N)N)=N\C |
| InChI | InChI=1S/C7H15N5/c1-4-5-12(3)7(10-2)11-6(8)9/h4H,1,5H2,2-3H3,(H4,8,9,10,11) |
| InChIKey | QJMWSOKCDKGMLD-UHFFFAOYSA-N |
| XLogP | -0.64 |
| TPSA | 80.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.23 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-(diaminomethylidene)-1,2-dimethyl-1-prop-2-enylguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(diaminomethylidene)-1,2-dimethyl-1-prop-2-enylguanidine?
The IUPAC name of 3-(diaminomethylidene)-1,2-dimethyl-1-prop-2-enylguanidine (CID 22915573) is 3-(diaminomethylidene)-1,2-dimethyl-1-prop-2-enylguanidine.
What is the SMILES notation for 3-(diaminomethylidene)-1,2-dimethyl-1-prop-2-enylguanidine?
The canonical SMILES for 3-(diaminomethylidene)-1,2-dimethyl-1-prop-2-enylguanidine is C=CCN(C)/C(N=C(N)N)=N\C.
What is the InChIKey of 3-(diaminomethylidene)-1,2-dimethyl-1-prop-2-enylguanidine?
The InChIKey is QJMWSOKCDKGMLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15N5/c1-4-5-12(3)7(10-2)11-6(8)9/h4H,1,5H2,2-3H3,(H4,8,9,10,11).
What are the key properties of 3-(diaminomethylidene)-1,2-dimethyl-1-prop-2-enylguanidine?
3-(diaminomethylidene)-1,2-dimethyl-1-prop-2-enylguanidine has a molecular weight of 169.23 g/mol, XLogP of -0.64, 2 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(diaminomethylidene)-1,2-dimethyl-1-prop-2-enylguanidine is sourced from PubChem (CID 22915573), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).