C15H30N6O9 — CID 22915577
1-[[4,6-bis[(1-hydroxy-2,2-dimethoxyethyl)amino]-1,3,5-triazin-2-yl]amino]-2,2-dimethoxyethanol (PubChem CID 22915577) has the molecular formula C15H30N6O9 and a molecular weight of 438.44 g/mol. Its IUPAC name is 1-[[4,6-bis[(1-hydroxy-2,2-dimethoxyethyl)amino]-1,3,5-triazin-2-yl]amino]-2,2-dimethoxyethanol.
| Compound Name | 1-[[4,6-bis[(1-hydroxy-2,2-dimethoxyethyl)amino]-1,3,5-triazin-2-yl]amino]-2,2-dimethoxyethanol |
|---|---|
| PubChem CID | 22915577 |
| Molecular Formula | C15H30N6O9 |
| Molecular Weight | 438.44 g/mol |
| Exact Mass | 438.21 |
| IUPAC Name | 1-[[4,6-bis[(1-hydroxy-2,2-dimethoxyethyl)amino]-1,3,5-triazin-2-yl]amino]-2,2-dimethoxyethanol |
| SMILES | COC(OC)C(O)Nc1nc(NC(O)C(OC)OC)nc(NC(O)C(OC)OC)n1 |
| InChI | InChI=1S/C15H30N6O9/c1-25-10(26-2)7(22)16-13-19-14(17-8(23)11(27-3)28-4)21-15(20-13)18-9(24)12(29-5)30-6/h7-12,22-24H,1-6H3,(H3,16,17,18,19,20,21) |
| InChIKey | PKHFATMKDARGLK-UHFFFAOYSA-N |
| XLogP | -2.08 |
| TPSA | 190.83 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.44 |
| LogP ≤ 5 | -2.08 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|