About methyl 2-[3,5-bis(trifluoromethyl)phenyl]-2-(2-phenylpiperidin-3-yl)oxyacetate
methyl 2-[3,5-bis(trifluoromethyl)phenyl]-2-(2-phenylpiperidin-3-yl)oxyacetate (PubChem CID 22915655) has the molecular formula C22H21F6NO3
and a molecular weight of 461.40 g/mol. Its IUPAC name is methyl 2-[3,5-bis(trifluoromethyl)phenyl]-2-(2-phenylpiperidin-3-yl)oxyacetate.
Molecular Properties
| Compound Name | methyl 2-[3,5-bis(trifluoromethyl)phenyl]-2-(2-phenylpiperidin-3-yl)oxyacetate |
| PubChem CID | 22915655 |
| Molecular Formula | C22H21F6NO3 |
| Molecular Weight | 461.40 g/mol |
| Exact Mass | 461.14 |
| IUPAC Name | methyl 2-[3,5-bis(trifluoromethyl)phenyl]-2-(2-phenylpiperidin-3-yl)oxyacetate |
| SMILES | COC(=O)C(OC1CCCNC1c1ccccc1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H21F6NO3/c1-31-20(30)19(14-10-15(21(23,24)25)12-16(11-14)22(26,27)28)32-17-8-5-9-29-18(17)13-6-3-2-4-7-13/h2-4,6-7,10-12,17-19,29H,5,8-9H2,1H3 |
| InChIKey | BFYRGOYUNJFBPR-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 461.40 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 2-[3,5-bis(trifluoromethyl)phenyl]-2-(2-phenylpiperidin-3-yl)oxyacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[3,5-bis(trifluoromethyl)phenyl]-2-(2-phenylpiperidin-3-yl)oxyacetate?
The IUPAC name of methyl 2-[3,5-bis(trifluoromethyl)phenyl]-2-(2-phenylpiperidin-3-yl)oxyacetate (CID 22915655) is methyl 2-[3,5-bis(trifluoromethyl)phenyl]-2-(2-phenylpiperidin-3-yl)oxyacetate.
What is the SMILES notation for methyl 2-[3,5-bis(trifluoromethyl)phenyl]-2-(2-phenylpiperidin-3-yl)oxyacetate?
The canonical SMILES for methyl 2-[3,5-bis(trifluoromethyl)phenyl]-2-(2-phenylpiperidin-3-yl)oxyacetate is COC(=O)C(OC1CCCNC1c1ccccc1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1.
What is the InChIKey of methyl 2-[3,5-bis(trifluoromethyl)phenyl]-2-(2-phenylpiperidin-3-yl)oxyacetate?
The InChIKey is BFYRGOYUNJFBPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H21F6NO3/c1-31-20(30)19(14-10-15(21(23,24)25)12-16(11-14)22(26,27)28)32-17-8-5-9-29-18(17)13-6-3-2-4-7-13/h2-4,6-7,10-12,17-19,29H,5,8-9H2,1H3.
What are the key properties of methyl 2-[3,5-bis(trifluoromethyl)phenyl]-2-(2-phenylpiperidin-3-yl)oxyacetate?
methyl 2-[3,5-bis(trifluoromethyl)phenyl]-2-(2-phenylpiperidin-3-yl)oxyacetate has a molecular weight of 461.40 g/mol, XLogP of 5.45, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[3,5-bis(trifluoromethyl)phenyl]-2-(2-phenylpiperidin-3-yl)oxyacetate is sourced from PubChem (CID 22915655), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).