About 1-[(3E)-hexa-3,5-dienyl]-4-[4-(trifluoromethoxy)cyclohexyl]cyclohexane
1-[(3E)-hexa-3,5-dienyl]-4-[4-(trifluoromethoxy)cyclohexyl]cyclohexane (PubChem CID 22915888) has the molecular formula C19H29F3O
and a molecular weight of 330.43 g/mol. Its IUPAC name is 1-[(3E)-hexa-3,5-dienyl]-4-[4-(trifluoromethoxy)cyclohexyl]cyclohexane.
Molecular Properties
| Compound Name | 1-[(3E)-hexa-3,5-dienyl]-4-[4-(trifluoromethoxy)cyclohexyl]cyclohexane |
| PubChem CID | 22915888 |
| Molecular Formula | C19H29F3O |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.22 |
| IUPAC Name | 1-[(3E)-hexa-3,5-dienyl]-4-[4-(trifluoromethoxy)cyclohexyl]cyclohexane |
| SMILES | C=C/C=C/CCC1CCC(C2CCC(OC(F)(F)F)CC2)CC1 |
| InChI | InChI=1S/C19H29F3O/c1-2-3-4-5-6-15-7-9-16(10-8-15)17-11-13-18(14-12-17)23-19(20,21)22/h2-4,15-18H,1,5-14H2/b4-3+ |
| InChIKey | TWZFLMVXFBJCSZ-ONEGZZNKSA-N |
| XLogP | 6.41 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-[(3E)-hexa-3,5-dienyl]-4-[4-(trifluoromethoxy)cyclohexyl]cyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3E)-hexa-3,5-dienyl]-4-[4-(trifluoromethoxy)cyclohexyl]cyclohexane?
The IUPAC name of 1-[(3E)-hexa-3,5-dienyl]-4-[4-(trifluoromethoxy)cyclohexyl]cyclohexane (CID 22915888) is 1-[(3E)-hexa-3,5-dienyl]-4-[4-(trifluoromethoxy)cyclohexyl]cyclohexane.
What is the SMILES notation for 1-[(3E)-hexa-3,5-dienyl]-4-[4-(trifluoromethoxy)cyclohexyl]cyclohexane?
The canonical SMILES for 1-[(3E)-hexa-3,5-dienyl]-4-[4-(trifluoromethoxy)cyclohexyl]cyclohexane is C=C/C=C/CCC1CCC(C2CCC(OC(F)(F)F)CC2)CC1.
What is the InChIKey of 1-[(3E)-hexa-3,5-dienyl]-4-[4-(trifluoromethoxy)cyclohexyl]cyclohexane?
The InChIKey is TWZFLMVXFBJCSZ-ONEGZZNKSA-N. The full InChI is InChI=1S/C19H29F3O/c1-2-3-4-5-6-15-7-9-16(10-8-15)17-11-13-18(14-12-17)23-19(20,21)22/h2-4,15-18H,1,5-14H2/b4-3+.
What are the key properties of 1-[(3E)-hexa-3,5-dienyl]-4-[4-(trifluoromethoxy)cyclohexyl]cyclohexane?
1-[(3E)-hexa-3,5-dienyl]-4-[4-(trifluoromethoxy)cyclohexyl]cyclohexane has a molecular weight of 330.43 g/mol, XLogP of 6.41, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3E)-hexa-3,5-dienyl]-4-[4-(trifluoromethoxy)cyclohexyl]cyclohexane is sourced from PubChem (CID 22915888), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).