C6H8N2OS — CID 22916690
N-[(5-methyl-1,3-thiazol-2-yl)methyl]formamide (PubChem CID 22916690) has the molecular formula C6H8N2OS and a molecular weight of 156.21 g/mol. Its IUPAC name is N-[(5-methyl-1,3-thiazol-2-yl)methyl]formamide.
| Compound Name | N-[(5-methyl-1,3-thiazol-2-yl)methyl]formamide |
|---|---|
| PubChem CID | 22916690 |
| Molecular Formula | C6H8N2OS |
| Molecular Weight | 156.21 g/mol |
| Exact Mass | 156.04 |
| IUPAC Name | N-[(5-methyl-1,3-thiazol-2-yl)methyl]formamide |
| SMILES | Cc1cnc(CNC=O)s1 |
| InChI | InChI=1S/C6H8N2OS/c1-5-2-8-6(10-5)3-7-4-9/h2,4H,3H2,1H3,(H,7,9) |
| InChIKey | PSEAMBTXBKATMF-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.21 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|