About 2-formamido-2-(1,3-thiazol-2-yl)butanoic acid
2-formamido-2-(1,3-thiazol-2-yl)butanoic acid (PubChem CID 22916727) has the molecular formula C8H10N2O3S
and a molecular weight of 214.25 g/mol. Its IUPAC name is 2-formamido-2-(1,3-thiazol-2-yl)butanoic acid.
Molecular Properties
| Compound Name | 2-formamido-2-(1,3-thiazol-2-yl)butanoic acid |
| PubChem CID | 22916727 |
| Molecular Formula | C8H10N2O3S |
| Molecular Weight | 214.25 g/mol |
| Exact Mass | 214.04 |
| IUPAC Name | 2-formamido-2-(1,3-thiazol-2-yl)butanoic acid |
| SMILES | CCC(NC=O)(C(=O)O)c1nccs1 |
| InChI | InChI=1S/C8H10N2O3S/c1-2-8(7(12)13,10-5-11)6-9-3-4-14-6/h3-5H,2H2,1H3,(H,10,11)(H,12,13) |
| InChIKey | MPCIVSRQWQQDBK-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.25 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-formamido-2-(1,3-thiazol-2-yl)butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-formamido-2-(1,3-thiazol-2-yl)butanoic acid?
The IUPAC name of 2-formamido-2-(1,3-thiazol-2-yl)butanoic acid (CID 22916727) is 2-formamido-2-(1,3-thiazol-2-yl)butanoic acid.
What is the SMILES notation for 2-formamido-2-(1,3-thiazol-2-yl)butanoic acid?
The canonical SMILES for 2-formamido-2-(1,3-thiazol-2-yl)butanoic acid is CCC(NC=O)(C(=O)O)c1nccs1.
What is the InChIKey of 2-formamido-2-(1,3-thiazol-2-yl)butanoic acid?
The InChIKey is MPCIVSRQWQQDBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2O3S/c1-2-8(7(12)13,10-5-11)6-9-3-4-14-6/h3-5H,2H2,1H3,(H,10,11)(H,12,13).
What are the key properties of 2-formamido-2-(1,3-thiazol-2-yl)butanoic acid?
2-formamido-2-(1,3-thiazol-2-yl)butanoic acid has a molecular weight of 214.25 g/mol, XLogP of 0.58, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-formamido-2-(1,3-thiazol-2-yl)butanoic acid is sourced from PubChem (CID 22916727), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).