About 4-[4,4-bis(hydroxymethyl)-2-[4-(trifluoromethyl)phenyl]cyclopenten-1-yl]benzenesulfonamide
4-[4,4-bis(hydroxymethyl)-2-[4-(trifluoromethyl)phenyl]cyclopenten-1-yl]benzenesulfonamide (PubChem CID 22917266) has the molecular formula C20H20F3NO4S
and a molecular weight of 427.44 g/mol. Its IUPAC name is 4-[4,4-bis(hydroxymethyl)-2-[4-(trifluoromethyl)phenyl]cyclopenten-1-yl]benzenesulfonamide.
Molecular Properties
| Compound Name | 4-[4,4-bis(hydroxymethyl)-2-[4-(trifluoromethyl)phenyl]cyclopenten-1-yl]benzenesulfonamide |
| PubChem CID | 22917266 |
| Molecular Formula | C20H20F3NO4S |
| Molecular Weight | 427.44 g/mol |
| Exact Mass | 427.11 |
| IUPAC Name | 4-[4,4-bis(hydroxymethyl)-2-[4-(trifluoromethyl)phenyl]cyclopenten-1-yl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(C2=C(c3ccc(C(F)(F)F)cc3)CC(CO)(CO)C2)cc1 |
| InChI | InChI=1S/C20H20F3NO4S/c21-20(22,23)15-5-1-13(2-6-15)17-9-19(11-25,12-26)10-18(17)14-3-7-16(8-4-14)29(24,27)28/h1-8,25-26H,9-12H2,(H2,24,27,28) |
| InChIKey | WXPFMNBUIYBLMO-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 427.44 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 4-[4,4-bis(hydroxymethyl)-2-[4-(trifluoromethyl)phenyl]cyclopenten-1-yl]benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4,4-bis(hydroxymethyl)-2-[4-(trifluoromethyl)phenyl]cyclopenten-1-yl]benzenesulfonamide?
The IUPAC name of 4-[4,4-bis(hydroxymethyl)-2-[4-(trifluoromethyl)phenyl]cyclopenten-1-yl]benzenesulfonamide (CID 22917266) is 4-[4,4-bis(hydroxymethyl)-2-[4-(trifluoromethyl)phenyl]cyclopenten-1-yl]benzenesulfonamide.
What is the SMILES notation for 4-[4,4-bis(hydroxymethyl)-2-[4-(trifluoromethyl)phenyl]cyclopenten-1-yl]benzenesulfonamide?
The canonical SMILES for 4-[4,4-bis(hydroxymethyl)-2-[4-(trifluoromethyl)phenyl]cyclopenten-1-yl]benzenesulfonamide is NS(=O)(=O)c1ccc(C2=C(c3ccc(C(F)(F)F)cc3)CC(CO)(CO)C2)cc1.
What is the InChIKey of 4-[4,4-bis(hydroxymethyl)-2-[4-(trifluoromethyl)phenyl]cyclopenten-1-yl]benzenesulfonamide?
The InChIKey is WXPFMNBUIYBLMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20F3NO4S/c21-20(22,23)15-5-1-13(2-6-15)17-9-19(11-25,12-26)10-18(17)14-3-7-16(8-4-14)29(24,27)28/h1-8,25-26H,9-12H2,(H2,24,27,28).
What are the key properties of 4-[4,4-bis(hydroxymethyl)-2-[4-(trifluoromethyl)phenyl]cyclopenten-1-yl]benzenesulfonamide?
4-[4,4-bis(hydroxymethyl)-2-[4-(trifluoromethyl)phenyl]cyclopenten-1-yl]benzenesulfonamide has a molecular weight of 427.44 g/mol, XLogP of 3.03, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4,4-bis(hydroxymethyl)-2-[4-(trifluoromethyl)phenyl]cyclopenten-1-yl]benzenesulfonamide is sourced from PubChem (CID 22917266), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).