About 4-isocyanato-1,1-dimethylcyclohexane
4-isocyanato-1,1-dimethylcyclohexane (PubChem CID 22917808) has the molecular formula C9H15NO
and a molecular weight of 153.22 g/mol. Its IUPAC name is 4-isocyanato-1,1-dimethylcyclohexane.
Molecular Properties
| Compound Name | 4-isocyanato-1,1-dimethylcyclohexane |
| PubChem CID | 22917808 |
| Molecular Formula | C9H15NO |
| Molecular Weight | 153.22 g/mol |
| Exact Mass | 153.12 |
| IUPAC Name | 4-isocyanato-1,1-dimethylcyclohexane |
| SMILES | CC1(C)CCC(N=C=O)CC1 |
| InChI | InChI=1S/C9H15NO/c1-9(2)5-3-8(4-6-9)10-7-11/h8H,3-6H2,1-2H3 |
| InChIKey | YBDUOSLZPXYPDV-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.22 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 4-isocyanato-1,1-dimethylcyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-isocyanato-1,1-dimethylcyclohexane?
The IUPAC name of 4-isocyanato-1,1-dimethylcyclohexane (CID 22917808) is 4-isocyanato-1,1-dimethylcyclohexane.
What is the SMILES notation for 4-isocyanato-1,1-dimethylcyclohexane?
The canonical SMILES for 4-isocyanato-1,1-dimethylcyclohexane is CC1(C)CCC(N=C=O)CC1.
What is the InChIKey of 4-isocyanato-1,1-dimethylcyclohexane?
The InChIKey is YBDUOSLZPXYPDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15NO/c1-9(2)5-3-8(4-6-9)10-7-11/h8H,3-6H2,1-2H3.
What are the key properties of 4-isocyanato-1,1-dimethylcyclohexane?
4-isocyanato-1,1-dimethylcyclohexane has a molecular weight of 153.22 g/mol, XLogP of 2.29, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-isocyanato-1,1-dimethylcyclohexane is sourced from PubChem (CID 22917808), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).