About butyl 2-methylprop-2-enoate;ethyl 2-methylprop-2-enoate
butyl 2-methylprop-2-enoate;ethyl 2-methylprop-2-enoate (PubChem CID 22917869) has the molecular formula C14H24O4
and a molecular weight of 256.34 g/mol. Its IUPAC name is butyl 2-methylprop-2-enoate;ethyl 2-methylprop-2-enoate.
Molecular Properties
| Compound Name | butyl 2-methylprop-2-enoate;ethyl 2-methylprop-2-enoate |
| PubChem CID | 22917869 |
| Molecular Formula | C14H24O4 |
| Molecular Weight | 256.34 g/mol |
| Exact Mass | 256.17 |
| IUPAC Name | butyl 2-methylprop-2-enoate;ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC.C=C(C)C(=O)OCCCC |
| InChI | InChI=1S/C8H14O2.C6H10O2/c1-4-5-6-10-8(9)7(2)3;1-4-8-6(7)5(2)3/h2,4-6H2,1,3H3;2,4H2,1,3H3 |
| InChIKey | UHBIKYZYYOEGHM-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.34 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze butyl 2-methylprop-2-enoate;ethyl 2-methylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl 2-methylprop-2-enoate;ethyl 2-methylprop-2-enoate?
The IUPAC name of butyl 2-methylprop-2-enoate;ethyl 2-methylprop-2-enoate (CID 22917869) is butyl 2-methylprop-2-enoate;ethyl 2-methylprop-2-enoate.
What is the SMILES notation for butyl 2-methylprop-2-enoate;ethyl 2-methylprop-2-enoate?
The canonical SMILES for butyl 2-methylprop-2-enoate;ethyl 2-methylprop-2-enoate is C=C(C)C(=O)OCC.C=C(C)C(=O)OCCCC.
What is the InChIKey of butyl 2-methylprop-2-enoate;ethyl 2-methylprop-2-enoate?
The InChIKey is UHBIKYZYYOEGHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O2.C6H10O2/c1-4-5-6-10-8(9)7(2)3;1-4-8-6(7)5(2)3/h2,4-6H2,1,3H3;2,4H2,1,3H3.
What are the key properties of butyl 2-methylprop-2-enoate;ethyl 2-methylprop-2-enoate?
butyl 2-methylprop-2-enoate;ethyl 2-methylprop-2-enoate has a molecular weight of 256.34 g/mol, XLogP of 3.03, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for butyl 2-methylprop-2-enoate;ethyl 2-methylprop-2-enoate is sourced from PubChem (CID 22917869), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).