About N-(2-ethenoxyethyl)-N'-(2-methylpropyl)oxamide
N-(2-ethenoxyethyl)-N'-(2-methylpropyl)oxamide (PubChem CID 2291810) has the molecular formula C10H18N2O3
and a molecular weight of 214.26 g/mol. Its IUPAC name is N-(2-ethenoxyethyl)-N'-(2-methylpropyl)oxamide.
Molecular Properties
| Compound Name | N-(2-ethenoxyethyl)-N'-(2-methylpropyl)oxamide |
| PubChem CID | 2291810 |
| Molecular Formula | C10H18N2O3 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.13 |
| IUPAC Name | N-(2-ethenoxyethyl)-N'-(2-methylpropyl)oxamide |
| SMILES | C=COCCNC(=O)C(=O)NCC(C)C |
| InChI | InChI=1S/C10H18N2O3/c1-4-15-6-5-11-9(13)10(14)12-7-8(2)3/h4,8H,1,5-7H2,2-3H3,(H,11,13)(H,12,14) |
| InChIKey | ZHQVCWWUJRIKIT-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N-(2-ethenoxyethyl)-N'-(2-methylpropyl)oxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-ethenoxyethyl)-N'-(2-methylpropyl)oxamide?
The IUPAC name of N-(2-ethenoxyethyl)-N'-(2-methylpropyl)oxamide (CID 2291810) is N-(2-ethenoxyethyl)-N'-(2-methylpropyl)oxamide.
What is the SMILES notation for N-(2-ethenoxyethyl)-N'-(2-methylpropyl)oxamide?
The canonical SMILES for N-(2-ethenoxyethyl)-N'-(2-methylpropyl)oxamide is C=COCCNC(=O)C(=O)NCC(C)C.
What is the InChIKey of N-(2-ethenoxyethyl)-N'-(2-methylpropyl)oxamide?
The InChIKey is ZHQVCWWUJRIKIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N2O3/c1-4-15-6-5-11-9(13)10(14)12-7-8(2)3/h4,8H,1,5-7H2,2-3H3,(H,11,13)(H,12,14).
What are the key properties of N-(2-ethenoxyethyl)-N'-(2-methylpropyl)oxamide?
N-(2-ethenoxyethyl)-N'-(2-methylpropyl)oxamide has a molecular weight of 214.26 g/mol, XLogP of 0.03, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-ethenoxyethyl)-N'-(2-methylpropyl)oxamide is sourced from PubChem (CID 2291810), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).