About ethyl (E)-5-(5-acetyloxy-4,6-ditert-butyl-2-methyl-3H-1-benzofuran-2-yl)-2-methylpent-2-enoate
ethyl (E)-5-(5-acetyloxy-4,6-ditert-butyl-2-methyl-3H-1-benzofuran-2-yl)-2-methylpent-2-enoate (PubChem CID 22918661) has the molecular formula C27H40O5
and a molecular weight of 444.61 g/mol. Its IUPAC name is ethyl (E)-5-(5-acetyloxy-4,6-ditert-butyl-2-methyl-3H-1-benzofuran-2-yl)-2-methylpent-2-enoate.
Molecular Properties
| Compound Name | ethyl (E)-5-(5-acetyloxy-4,6-ditert-butyl-2-methyl-3H-1-benzofuran-2-yl)-2-methylpent-2-enoate |
| PubChem CID | 22918661 |
| Molecular Formula | C27H40O5 |
| Molecular Weight | 444.61 g/mol |
| Exact Mass | 444.29 |
| IUPAC Name | ethyl (E)-5-(5-acetyloxy-4,6-ditert-butyl-2-methyl-3H-1-benzofuran-2-yl)-2-methylpent-2-enoate |
| SMILES | CCOC(=O)/C(C)=C/CCC1(C)Cc2c(cc(C(C)(C)C)c(OC(C)=O)c2C(C)(C)C)O1 |
| InChI | InChI=1S/C27H40O5/c1-11-30-24(29)17(2)13-12-14-27(10)16-19-21(32-27)15-20(25(4,5)6)23(31-18(3)28)22(19)26(7,8)9/h13,15H,11-12,14,16H2,1-10H3/b17-13+ |
| InChIKey | DCUNCZYCNWEUTO-GHRIWEEISA-N |
| XLogP | 6.19 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 444.61 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze ethyl (E)-5-(5-acetyloxy-4,6-ditert-butyl-2-methyl-3H-1-benzofuran-2-yl)-2-methylpent-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (E)-5-(5-acetyloxy-4,6-ditert-butyl-2-methyl-3H-1-benzofuran-2-yl)-2-methylpent-2-enoate?
The IUPAC name of ethyl (E)-5-(5-acetyloxy-4,6-ditert-butyl-2-methyl-3H-1-benzofuran-2-yl)-2-methylpent-2-enoate (CID 22918661) is ethyl (E)-5-(5-acetyloxy-4,6-ditert-butyl-2-methyl-3H-1-benzofuran-2-yl)-2-methylpent-2-enoate.
What is the SMILES notation for ethyl (E)-5-(5-acetyloxy-4,6-ditert-butyl-2-methyl-3H-1-benzofuran-2-yl)-2-methylpent-2-enoate?
The canonical SMILES for ethyl (E)-5-(5-acetyloxy-4,6-ditert-butyl-2-methyl-3H-1-benzofuran-2-yl)-2-methylpent-2-enoate is CCOC(=O)/C(C)=C/CCC1(C)Cc2c(cc(C(C)(C)C)c(OC(C)=O)c2C(C)(C)C)O1.
What is the InChIKey of ethyl (E)-5-(5-acetyloxy-4,6-ditert-butyl-2-methyl-3H-1-benzofuran-2-yl)-2-methylpent-2-enoate?
The InChIKey is DCUNCZYCNWEUTO-GHRIWEEISA-N. The full InChI is InChI=1S/C27H40O5/c1-11-30-24(29)17(2)13-12-14-27(10)16-19-21(32-27)15-20(25(4,5)6)23(31-18(3)28)22(19)26(7,8)9/h13,15H,11-12,14,16H2,1-10H3/b17-13+.
What are the key properties of ethyl (E)-5-(5-acetyloxy-4,6-ditert-butyl-2-methyl-3H-1-benzofuran-2-yl)-2-methylpent-2-enoate?
ethyl (E)-5-(5-acetyloxy-4,6-ditert-butyl-2-methyl-3H-1-benzofuran-2-yl)-2-methylpent-2-enoate has a molecular weight of 444.61 g/mol, XLogP of 6.19, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (E)-5-(5-acetyloxy-4,6-ditert-butyl-2-methyl-3H-1-benzofuran-2-yl)-2-methylpent-2-enoate is sourced from PubChem (CID 22918661), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).