C21H17N3O4 — CID 22918684
2-amino-7-methoxy-4-(4-nitrophenyl)-5,6-dihydro-4H-benzo[h]chromene-3-carbonitrile (PubChem CID 22918684) has the molecular formula C21H17N3O4 and a molecular weight of 375.38 g/mol. Its IUPAC name is 2-amino-7-methoxy-4-(4-nitrophenyl)-5,6-dihydro-4H-benzo[h]chromene-3-carbonitrile.
| Compound Name | 2-amino-7-methoxy-4-(4-nitrophenyl)-5,6-dihydro-4H-benzo[h]chromene-3-carbonitrile |
|---|---|
| PubChem CID | 22918684 |
| Molecular Formula | C21H17N3O4 |
| Molecular Weight | 375.38 g/mol |
| Exact Mass | 375.12 |
| IUPAC Name | 2-amino-7-methoxy-4-(4-nitrophenyl)-5,6-dihydro-4H-benzo[h]chromene-3-carbonitrile |
| SMILES | COc1cccc2c1CCC1=C2OC(N)=C(C#N)C1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H17N3O4/c1-27-18-4-2-3-15-14(18)9-10-16-19(17(11-22)21(23)28-20(15)16)12-5-7-13(8-6-12)24(25)26/h2-8,19H,9-10,23H2,1H3 |
| InChIKey | FXHUWIJTQYQWMU-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 111.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.38 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|