C24H16Cl2N2O3 — CID 22918754
4-(3,4-dichlorophenyl)-2-(2,5-dioxopyrrolidin-1-yl)-5,6-dihydro-4H-benzo[h]chromene-3-carbonitrile (PubChem CID 22918754) has the molecular formula C24H16Cl2N2O3 and a molecular weight of 451.31 g/mol. Its IUPAC name is 4-(3,4-dichlorophenyl)-2-(2,5-dioxopyrrolidin-1-yl)-5,6-dihydro-4H-benzo[h]chromene-3-carbonitrile.
| Compound Name | 4-(3,4-dichlorophenyl)-2-(2,5-dioxopyrrolidin-1-yl)-5,6-dihydro-4H-benzo[h]chromene-3-carbonitrile |
|---|---|
| PubChem CID | 22918754 |
| Molecular Formula | C24H16Cl2N2O3 |
| Molecular Weight | 451.31 g/mol |
| Exact Mass | 450.05 |
| IUPAC Name | 4-(3,4-dichlorophenyl)-2-(2,5-dioxopyrrolidin-1-yl)-5,6-dihydro-4H-benzo[h]chromene-3-carbonitrile |
| SMILES | N#CC1=C(N2C(=O)CCC2=O)OC2=C(CCc3ccccc32)C1c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C24H16Cl2N2O3/c25-18-8-6-14(11-19(18)26)22-16-7-5-13-3-1-2-4-15(13)23(16)31-24(17(22)12-27)28-20(29)9-10-21(28)30/h1-4,6,8,11,22H,5,7,9-10H2 |
| InChIKey | RBQCRCZMGHEODN-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 70.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.31 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|