About 3-ethyl-8-[methyl(thiophen-2-yl)amino]-1H-imidazo[4,5-g]quinazoline-2-thione;hydrochloride
3-ethyl-8-[methyl(thiophen-2-yl)amino]-1H-imidazo[4,5-g]quinazoline-2-thione;hydrochloride (PubChem CID 22921808) has the molecular formula C16H16ClN5S2
and a molecular weight of 377.93 g/mol. Its IUPAC name is 3-ethyl-8-[methyl(thiophen-2-yl)amino]-1H-imidazo[4,5-g]quinazoline-2-thione;hydrochloride.
Molecular Properties
| Compound Name | 3-ethyl-8-[methyl(thiophen-2-yl)amino]-1H-imidazo[4,5-g]quinazoline-2-thione;hydrochloride |
| PubChem CID | 22921808 |
| Molecular Formula | C16H16ClN5S2 |
| Molecular Weight | 377.93 g/mol |
| Exact Mass | 377.05 |
| IUPAC Name | 3-ethyl-8-[methyl(thiophen-2-yl)amino]-1H-imidazo[4,5-g]quinazoline-2-thione;hydrochloride |
| SMILES | CCn1c(=S)[nH]c2cc3c(N(C)c4cccs4)ncnc3cc21.Cl |
| InChI | InChI=1S/C16H15N5S2.ClH/c1-3-21-13-8-11-10(7-12(13)19-16(21)22)15(18-9-17-11)20(2)14-5-4-6-23-14;/h4-9H,3H2,1-2H3,(H,19,22);1H |
| InChIKey | UXJURIPSCBAYLC-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 49.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.93 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-ethyl-8-[methyl(thiophen-2-yl)amino]-1H-imidazo[4,5-g]quinazoline-2-thione;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-8-[methyl(thiophen-2-yl)amino]-1H-imidazo[4,5-g]quinazoline-2-thione;hydrochloride?
The IUPAC name of 3-ethyl-8-[methyl(thiophen-2-yl)amino]-1H-imidazo[4,5-g]quinazoline-2-thione;hydrochloride (CID 22921808) is 3-ethyl-8-[methyl(thiophen-2-yl)amino]-1H-imidazo[4,5-g]quinazoline-2-thione;hydrochloride.
What is the SMILES notation for 3-ethyl-8-[methyl(thiophen-2-yl)amino]-1H-imidazo[4,5-g]quinazoline-2-thione;hydrochloride?
The canonical SMILES for 3-ethyl-8-[methyl(thiophen-2-yl)amino]-1H-imidazo[4,5-g]quinazoline-2-thione;hydrochloride is CCn1c(=S)[nH]c2cc3c(N(C)c4cccs4)ncnc3cc21.Cl.
What is the InChIKey of 3-ethyl-8-[methyl(thiophen-2-yl)amino]-1H-imidazo[4,5-g]quinazoline-2-thione;hydrochloride?
The InChIKey is UXJURIPSCBAYLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15N5S2.ClH/c1-3-21-13-8-11-10(7-12(13)19-16(21)22)15(18-9-17-11)20(2)14-5-4-6-23-14;/h4-9H,3H2,1-2H3,(H,19,22);1H.
What are the key properties of 3-ethyl-8-[methyl(thiophen-2-yl)amino]-1H-imidazo[4,5-g]quinazoline-2-thione;hydrochloride?
3-ethyl-8-[methyl(thiophen-2-yl)amino]-1H-imidazo[4,5-g]quinazoline-2-thione;hydrochloride has a molecular weight of 377.93 g/mol, XLogP of 4.91, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-8-[methyl(thiophen-2-yl)amino]-1H-imidazo[4,5-g]quinazoline-2-thione;hydrochloride is sourced from PubChem (CID 22921808), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).