About 3-ethyl-8-(4-methyl-1,4-diazepan-1-yl)-1H-imidazo[4,5-g]quinazolin-2-one;dihydrochloride
3-ethyl-8-(4-methyl-1,4-diazepan-1-yl)-1H-imidazo[4,5-g]quinazolin-2-one;dihydrochloride (PubChem CID 22921938) has the molecular formula C17H24Cl2N6O
and a molecular weight of 399.33 g/mol. Its IUPAC name is 3-ethyl-8-(4-methyl-1,4-diazepan-1-yl)-1H-imidazo[4,5-g]quinazolin-2-one;dihydrochloride.
Molecular Properties
| Compound Name | 3-ethyl-8-(4-methyl-1,4-diazepan-1-yl)-1H-imidazo[4,5-g]quinazolin-2-one;dihydrochloride |
| PubChem CID | 22921938 |
| Molecular Formula | C17H24Cl2N6O |
| Molecular Weight | 399.33 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | 3-ethyl-8-(4-methyl-1,4-diazepan-1-yl)-1H-imidazo[4,5-g]quinazolin-2-one;dihydrochloride |
| SMILES | CCn1c(=O)[nH]c2cc3c(N4CCCN(C)CC4)ncnc3cc21.Cl.Cl |
| InChI | InChI=1S/C17H22N6O.2ClH/c1-3-23-15-10-13-12(9-14(15)20-17(23)24)16(19-11-18-13)22-6-4-5-21(2)7-8-22;;/h9-11H,3-8H2,1-2H3,(H,20,24);2*1H |
| InChIKey | VERYPYPLJLLGMU-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 70.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 399.33 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-ethyl-8-(4-methyl-1,4-diazepan-1-yl)-1H-imidazo[4,5-g]quinazolin-2-one;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-8-(4-methyl-1,4-diazepan-1-yl)-1H-imidazo[4,5-g]quinazolin-2-one;dihydrochloride?
The IUPAC name of 3-ethyl-8-(4-methyl-1,4-diazepan-1-yl)-1H-imidazo[4,5-g]quinazolin-2-one;dihydrochloride (CID 22921938) is 3-ethyl-8-(4-methyl-1,4-diazepan-1-yl)-1H-imidazo[4,5-g]quinazolin-2-one;dihydrochloride.
What is the SMILES notation for 3-ethyl-8-(4-methyl-1,4-diazepan-1-yl)-1H-imidazo[4,5-g]quinazolin-2-one;dihydrochloride?
The canonical SMILES for 3-ethyl-8-(4-methyl-1,4-diazepan-1-yl)-1H-imidazo[4,5-g]quinazolin-2-one;dihydrochloride is CCn1c(=O)[nH]c2cc3c(N4CCCN(C)CC4)ncnc3cc21.Cl.Cl.
What is the InChIKey of 3-ethyl-8-(4-methyl-1,4-diazepan-1-yl)-1H-imidazo[4,5-g]quinazolin-2-one;dihydrochloride?
The InChIKey is VERYPYPLJLLGMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22N6O.2ClH/c1-3-23-15-10-13-12(9-14(15)20-17(23)24)16(19-11-18-13)22-6-4-5-21(2)7-8-22;;/h9-11H,3-8H2,1-2H3,(H,20,24);2*1H.
What are the key properties of 3-ethyl-8-(4-methyl-1,4-diazepan-1-yl)-1H-imidazo[4,5-g]quinazolin-2-one;dihydrochloride?
3-ethyl-8-(4-methyl-1,4-diazepan-1-yl)-1H-imidazo[4,5-g]quinazolin-2-one;dihydrochloride has a molecular weight of 399.33 g/mol, XLogP of 2.28, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-8-(4-methyl-1,4-diazepan-1-yl)-1H-imidazo[4,5-g]quinazolin-2-one;dihydrochloride is sourced from PubChem (CID 22921938), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).