C26H25FN4O10 — CID 22921994
[6-(dimethylamino)-1-(4-fluorophenyl)-3-methyl-2,4-dioxopyrimidin-5-yl]-(3,4,5-triacetyloxyphenyl)carbamic acid (PubChem CID 22921994) has the molecular formula C26H25FN4O10 and a molecular weight of 572.50 g/mol. Its IUPAC name is [6-(dimethylamino)-1-(4-fluorophenyl)-3-methyl-2,4-dioxopyrimidin-5-yl]-(3,4,5-triacetyloxyphenyl)carbamic acid.
| Compound Name | [6-(dimethylamino)-1-(4-fluorophenyl)-3-methyl-2,4-dioxopyrimidin-5-yl]-(3,4,5-triacetyloxyphenyl)carbamic acid |
|---|---|
| PubChem CID | 22921994 |
| Molecular Formula | C26H25FN4O10 |
| Molecular Weight | 572.50 g/mol |
| Exact Mass | 572.16 |
| IUPAC Name | [6-(dimethylamino)-1-(4-fluorophenyl)-3-methyl-2,4-dioxopyrimidin-5-yl]-(3,4,5-triacetyloxyphenyl)carbamic acid |
| SMILES | CC(=O)Oc1cc(N(C(=O)O)c2c(N(C)C)n(-c3ccc(F)cc3)c(=O)n(C)c2=O)cc(OC(C)=O)c1OC(C)=O |
| InChI | InChI=1S/C26H25FN4O10/c1-13(32)39-19-11-18(12-20(40-14(2)33)22(19)41-15(3)34)30(26(37)38)21-23(28(4)5)31(25(36)29(6)24(21)35)17-9-7-16(27)8-10-17/h7-12H,1-6H3,(H,37,38) |
| InChIKey | HHZVVWOILXKOGK-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 166.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.50 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|