C24H21FN4O10 — CID 22922059
[6-amino-1-(4-fluorophenyl)-3-methyl-2,4-dioxopyrimidin-5-yl]-(3,4,5-triacetyloxyphenyl)carbamic acid (PubChem CID 22922059) has the molecular formula C24H21FN4O10 and a molecular weight of 544.45 g/mol. Its IUPAC name is [6-amino-1-(4-fluorophenyl)-3-methyl-2,4-dioxopyrimidin-5-yl]-(3,4,5-triacetyloxyphenyl)carbamic acid.
| Compound Name | [6-amino-1-(4-fluorophenyl)-3-methyl-2,4-dioxopyrimidin-5-yl]-(3,4,5-triacetyloxyphenyl)carbamic acid |
|---|---|
| PubChem CID | 22922059 |
| Molecular Formula | C24H21FN4O10 |
| Molecular Weight | 544.45 g/mol |
| Exact Mass | 544.12 |
| IUPAC Name | [6-amino-1-(4-fluorophenyl)-3-methyl-2,4-dioxopyrimidin-5-yl]-(3,4,5-triacetyloxyphenyl)carbamic acid |
| SMILES | CC(=O)Oc1cc(N(C(=O)O)c2c(N)n(-c3ccc(F)cc3)c(=O)n(C)c2=O)cc(OC(C)=O)c1OC(C)=O |
| InChI | InChI=1S/C24H21FN4O10/c1-11(30)37-17-9-16(10-18(38-12(2)31)20(17)39-13(3)32)28(24(35)36)19-21(26)29(23(34)27(4)22(19)33)15-7-5-14(25)6-8-15/h5-10H,26H2,1-4H3,(H,35,36) |
| InChIKey | SXTJEYSSZFVMFV-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 189.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.45 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|