About 5-methoxy-4,7,7-trimethyl-8-oxabicyclo[3.2.1]oct-3-en-2-one
5-methoxy-4,7,7-trimethyl-8-oxabicyclo[3.2.1]oct-3-en-2-one (PubChem CID 22922323) has the molecular formula C11H16O3
and a molecular weight of 196.25 g/mol. Its IUPAC name is 5-methoxy-4,7,7-trimethyl-8-oxabicyclo[3.2.1]oct-3-en-2-one.
Molecular Properties
| Compound Name | 5-methoxy-4,7,7-trimethyl-8-oxabicyclo[3.2.1]oct-3-en-2-one |
| PubChem CID | 22922323 |
| Molecular Formula | C11H16O3 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.11 |
| IUPAC Name | 5-methoxy-4,7,7-trimethyl-8-oxabicyclo[3.2.1]oct-3-en-2-one |
| SMILES | COC12CC(C)(C)C(O1)C(=O)C=C2C |
| InChI | InChI=1S/C11H16O3/c1-7-5-8(12)9-10(2,3)6-11(7,13-4)14-9/h5,9H,6H2,1-4H3 |
| InChIKey | HEAJGEYRUUEKBZ-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-methoxy-4,7,7-trimethyl-8-oxabicyclo[3.2.1]oct-3-en-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methoxy-4,7,7-trimethyl-8-oxabicyclo[3.2.1]oct-3-en-2-one?
The IUPAC name of 5-methoxy-4,7,7-trimethyl-8-oxabicyclo[3.2.1]oct-3-en-2-one (CID 22922323) is 5-methoxy-4,7,7-trimethyl-8-oxabicyclo[3.2.1]oct-3-en-2-one.
What is the SMILES notation for 5-methoxy-4,7,7-trimethyl-8-oxabicyclo[3.2.1]oct-3-en-2-one?
The canonical SMILES for 5-methoxy-4,7,7-trimethyl-8-oxabicyclo[3.2.1]oct-3-en-2-one is COC12CC(C)(C)C(O1)C(=O)C=C2C.
What is the InChIKey of 5-methoxy-4,7,7-trimethyl-8-oxabicyclo[3.2.1]oct-3-en-2-one?
The InChIKey is HEAJGEYRUUEKBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O3/c1-7-5-8(12)9-10(2,3)6-11(7,13-4)14-9/h5,9H,6H2,1-4H3.
What are the key properties of 5-methoxy-4,7,7-trimethyl-8-oxabicyclo[3.2.1]oct-3-en-2-one?
5-methoxy-4,7,7-trimethyl-8-oxabicyclo[3.2.1]oct-3-en-2-one has a molecular weight of 196.25 g/mol, XLogP of 1.67, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methoxy-4,7,7-trimethyl-8-oxabicyclo[3.2.1]oct-3-en-2-one is sourced from PubChem (CID 22922323), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).