C11H20O3 — CID 22922327
5-methoxy-4,7,7-trimethylcyclohept-3-ene-1,2-diol (PubChem CID 22922327) has the molecular formula C11H20O3 and a molecular weight of 200.28 g/mol. Its IUPAC name is 5-methoxy-4,7,7-trimethylcyclohept-3-ene-1,2-diol.
| Compound Name | 5-methoxy-4,7,7-trimethylcyclohept-3-ene-1,2-diol |
|---|---|
| PubChem CID | 22922327 |
| Molecular Formula | C11H20O3 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.14 |
| IUPAC Name | 5-methoxy-4,7,7-trimethylcyclohept-3-ene-1,2-diol |
| SMILES | COC1CC(C)(C)C(O)C(O)C=C1C |
| InChI | InChI=1S/C11H20O3/c1-7-5-8(12)10(13)11(2,3)6-9(7)14-4/h5,8-10,12-13H,6H2,1-4H3 |
| InChIKey | NLNVMUVSJXPDHC-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|