C13H24O3 — CID 22922334
3,4,7-trimethoxy-1,5,5-trimethylcycloheptene (PubChem CID 22922334) has the molecular formula C13H24O3 and a molecular weight of 228.33 g/mol. Its IUPAC name is 3,4,7-trimethoxy-1,5,5-trimethylcycloheptene.
| Compound Name | 3,4,7-trimethoxy-1,5,5-trimethylcycloheptene |
|---|---|
| PubChem CID | 22922334 |
| Molecular Formula | C13H24O3 |
| Molecular Weight | 228.33 g/mol |
| Exact Mass | 228.17 |
| IUPAC Name | 3,4,7-trimethoxy-1,5,5-trimethylcycloheptene |
| SMILES | COC1CC(C)(C)C(OC)C(OC)C=C1C |
| InChI | InChI=1S/C13H24O3/c1-9-7-10(14-4)12(16-6)13(2,3)8-11(9)15-5/h7,10-12H,8H2,1-6H3 |
| InChIKey | MFNVRKCYJNPDAU-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.33 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|