C18H24O4 — CID 22922404
2-(4-methoxyphenyl)-5,8,8-trimethyl-3a,6,7,8a-tetrahydrocyclohepta[d][1,3]dioxol-6-ol (PubChem CID 22922404) has the molecular formula C18H24O4 and a molecular weight of 304.39 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-5,8,8-trimethyl-3a,6,7,8a-tetrahydrocyclohepta[d][1,3]dioxol-6-ol.
| Compound Name | 2-(4-methoxyphenyl)-5,8,8-trimethyl-3a,6,7,8a-tetrahydrocyclohepta[d][1,3]dioxol-6-ol |
|---|---|
| PubChem CID | 22922404 |
| Molecular Formula | C18H24O4 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.17 |
| IUPAC Name | 2-(4-methoxyphenyl)-5,8,8-trimethyl-3a,6,7,8a-tetrahydrocyclohepta[d][1,3]dioxol-6-ol |
| SMILES | COc1ccc(C2OC3C=C(C)C(O)CC(C)(C)C3O2)cc1 |
| InChI | InChI=1S/C18H24O4/c1-11-9-15-16(18(2,3)10-14(11)19)22-17(21-15)12-5-7-13(20-4)8-6-12/h5-9,14-17,19H,10H2,1-4H3 |
| InChIKey | IWAHXZVPZJQLFL-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|