C13H22O3 — CID 22922438
2,2,5,8,8-pentamethyl-3a,6,7,8a-tetrahydrocyclohepta[d][1,3]dioxol-6-ol (PubChem CID 22922438) has the molecular formula C13H22O3 and a molecular weight of 226.32 g/mol. Its IUPAC name is 2,2,5,8,8-pentamethyl-3a,6,7,8a-tetrahydrocyclohepta[d][1,3]dioxol-6-ol.
| Compound Name | 2,2,5,8,8-pentamethyl-3a,6,7,8a-tetrahydrocyclohepta[d][1,3]dioxol-6-ol |
|---|---|
| PubChem CID | 22922438 |
| Molecular Formula | C13H22O3 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.16 |
| IUPAC Name | 2,2,5,8,8-pentamethyl-3a,6,7,8a-tetrahydrocyclohepta[d][1,3]dioxol-6-ol |
| SMILES | CC1=CC2OC(C)(C)OC2C(C)(C)CC1O |
| InChI | InChI=1S/C13H22O3/c1-8-6-10-11(16-13(4,5)15-10)12(2,3)7-9(8)14/h6,9-11,14H,7H2,1-5H3 |
| InChIKey | LHQNUMPWNKOCRD-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|