C14H24N4O4 — CID 22922495
4-ethoxy-2-N-(2-morpholin-4-ylethyl)-1-nitrocyclohexa-3,5-diene-1,2-diamine (PubChem CID 22922495) has the molecular formula C14H24N4O4 and a molecular weight of 312.37 g/mol. Its IUPAC name is 4-ethoxy-2-N-(2-morpholin-4-ylethyl)-1-nitrocyclohexa-3,5-diene-1,2-diamine.
| Compound Name | 4-ethoxy-2-N-(2-morpholin-4-ylethyl)-1-nitrocyclohexa-3,5-diene-1,2-diamine |
|---|---|
| PubChem CID | 22922495 |
| Molecular Formula | C14H24N4O4 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | 4-ethoxy-2-N-(2-morpholin-4-ylethyl)-1-nitrocyclohexa-3,5-diene-1,2-diamine |
| SMILES | CCOC1=CC(NCCN2CCOCC2)C(N)([N+](=O)[O-])C=C1 |
| InChI | InChI=1S/C14H24N4O4/c1-2-22-12-3-4-14(15,18(19)20)13(11-12)16-5-6-17-7-9-21-10-8-17/h3-4,11,13,16H,2,5-10,15H2,1H3 |
| InChIKey | NXTDEAWRDAHECV-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 102.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|