About 5-fluoro-4-imidazo[1,2-a]pyridin-2-yl-2-(trifluoromethyl)benzonitrile
5-fluoro-4-imidazo[1,2-a]pyridin-2-yl-2-(trifluoromethyl)benzonitrile (PubChem CID 22923090) has the molecular formula C15H7F4N3
and a molecular weight of 305.23 g/mol. Its IUPAC name is 5-fluoro-4-imidazo[1,2-a]pyridin-2-yl-2-(trifluoromethyl)benzonitrile.
Molecular Properties
| Compound Name | 5-fluoro-4-imidazo[1,2-a]pyridin-2-yl-2-(trifluoromethyl)benzonitrile |
| PubChem CID | 22923090 |
| Molecular Formula | C15H7F4N3 |
| Molecular Weight | 305.23 g/mol |
| Exact Mass | 305.06 |
| IUPAC Name | 5-fluoro-4-imidazo[1,2-a]pyridin-2-yl-2-(trifluoromethyl)benzonitrile |
| SMILES | N#Cc1cc(F)c(-c2cn3ccccc3n2)cc1C(F)(F)F |
| InChI | InChI=1S/C15H7F4N3/c16-12-5-9(7-20)11(15(17,18)19)6-10(12)13-8-22-4-2-1-3-14(22)21-13/h1-6,8H |
| InChIKey | MEUTXTODSYMVHE-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 41.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.23 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-fluoro-4-imidazo[1,2-a]pyridin-2-yl-2-(trifluoromethyl)benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-4-imidazo[1,2-a]pyridin-2-yl-2-(trifluoromethyl)benzonitrile?
The IUPAC name of 5-fluoro-4-imidazo[1,2-a]pyridin-2-yl-2-(trifluoromethyl)benzonitrile (CID 22923090) is 5-fluoro-4-imidazo[1,2-a]pyridin-2-yl-2-(trifluoromethyl)benzonitrile.
What is the SMILES notation for 5-fluoro-4-imidazo[1,2-a]pyridin-2-yl-2-(trifluoromethyl)benzonitrile?
The canonical SMILES for 5-fluoro-4-imidazo[1,2-a]pyridin-2-yl-2-(trifluoromethyl)benzonitrile is N#Cc1cc(F)c(-c2cn3ccccc3n2)cc1C(F)(F)F.
What is the InChIKey of 5-fluoro-4-imidazo[1,2-a]pyridin-2-yl-2-(trifluoromethyl)benzonitrile?
The InChIKey is MEUTXTODSYMVHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H7F4N3/c16-12-5-9(7-20)11(15(17,18)19)6-10(12)13-8-22-4-2-1-3-14(22)21-13/h1-6,8H.
What are the key properties of 5-fluoro-4-imidazo[1,2-a]pyridin-2-yl-2-(trifluoromethyl)benzonitrile?
5-fluoro-4-imidazo[1,2-a]pyridin-2-yl-2-(trifluoromethyl)benzonitrile has a molecular weight of 305.23 g/mol, XLogP of 4.03, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-4-imidazo[1,2-a]pyridin-2-yl-2-(trifluoromethyl)benzonitrile is sourced from PubChem (CID 22923090), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).