About 9a,10-dihydroacridine-1,9-dione
9a,10-dihydroacridine-1,9-dione (PubChem CID 22923123) has the molecular formula C13H9NO2
and a molecular weight of 211.22 g/mol. Its IUPAC name is 9a,10-dihydroacridine-1,9-dione.
Molecular Properties
| Compound Name | 9a,10-dihydroacridine-1,9-dione |
| PubChem CID | 22923123 |
| Molecular Formula | C13H9NO2 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.06 |
| IUPAC Name | 9a,10-dihydroacridine-1,9-dione |
| SMILES | O=C1C=CC=C2Nc3ccccc3C(=O)C12 |
| InChI | InChI=1S/C13H9NO2/c15-11-7-3-6-10-12(11)13(16)8-4-1-2-5-9(8)14-10/h1-7,12,14H |
| InChIKey | IWAPGMXVESUAKJ-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 9a,10-dihydroacridine-1,9-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9a,10-dihydroacridine-1,9-dione?
The IUPAC name of 9a,10-dihydroacridine-1,9-dione (CID 22923123) is 9a,10-dihydroacridine-1,9-dione.
What is the SMILES notation for 9a,10-dihydroacridine-1,9-dione?
The canonical SMILES for 9a,10-dihydroacridine-1,9-dione is O=C1C=CC=C2Nc3ccccc3C(=O)C12.
What is the InChIKey of 9a,10-dihydroacridine-1,9-dione?
The InChIKey is IWAPGMXVESUAKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9NO2/c15-11-7-3-6-10-12(11)13(16)8-4-1-2-5-9(8)14-10/h1-7,12,14H.
What are the key properties of 9a,10-dihydroacridine-1,9-dione?
9a,10-dihydroacridine-1,9-dione has a molecular weight of 211.22 g/mol, XLogP of 1.93, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9a,10-dihydroacridine-1,9-dione is sourced from PubChem (CID 22923123), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).