About 2-phenylethyl 2-[4-[4,4-bis(4-fluorophenyl)butyl]piperazin-1-yl]pyridine-3-carboxylate
2-phenylethyl 2-[4-[4,4-bis(4-fluorophenyl)butyl]piperazin-1-yl]pyridine-3-carboxylate (PubChem CID 22923300) has the molecular formula C34H35F2N3O2
and a molecular weight of 555.67 g/mol. Its IUPAC name is 2-phenylethyl 2-[4-[4,4-bis(4-fluorophenyl)butyl]piperazin-1-yl]pyridine-3-carboxylate.
Molecular Properties
| Compound Name | 2-phenylethyl 2-[4-[4,4-bis(4-fluorophenyl)butyl]piperazin-1-yl]pyridine-3-carboxylate |
| PubChem CID | 22923300 |
| Molecular Formula | C34H35F2N3O2 |
| Molecular Weight | 555.67 g/mol |
| Exact Mass | 555.27 |
| IUPAC Name | 2-phenylethyl 2-[4-[4,4-bis(4-fluorophenyl)butyl]piperazin-1-yl]pyridine-3-carboxylate |
| SMILES | O=C(OCCc1ccccc1)c1cccnc1N1CCN(CCCC(c2ccc(F)cc2)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C34H35F2N3O2/c35-29-14-10-27(11-15-29)31(28-12-16-30(36)17-13-28)9-5-20-38-21-23-39(24-22-38)33-32(8-4-19-37-33)34(40)41-25-18-26-6-2-1-3-7-26/h1-4,6-8,10-17,19,31H,5,9,18,20-25H2 |
| InChIKey | PPSFKXYTDFCKGE-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 555.67 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-phenylethyl 2-[4-[4,4-bis(4-fluorophenyl)butyl]piperazin-1-yl]pyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenylethyl 2-[4-[4,4-bis(4-fluorophenyl)butyl]piperazin-1-yl]pyridine-3-carboxylate?
The IUPAC name of 2-phenylethyl 2-[4-[4,4-bis(4-fluorophenyl)butyl]piperazin-1-yl]pyridine-3-carboxylate (CID 22923300) is 2-phenylethyl 2-[4-[4,4-bis(4-fluorophenyl)butyl]piperazin-1-yl]pyridine-3-carboxylate.
What is the SMILES notation for 2-phenylethyl 2-[4-[4,4-bis(4-fluorophenyl)butyl]piperazin-1-yl]pyridine-3-carboxylate?
The canonical SMILES for 2-phenylethyl 2-[4-[4,4-bis(4-fluorophenyl)butyl]piperazin-1-yl]pyridine-3-carboxylate is O=C(OCCc1ccccc1)c1cccnc1N1CCN(CCCC(c2ccc(F)cc2)c2ccc(F)cc2)CC1.
What is the InChIKey of 2-phenylethyl 2-[4-[4,4-bis(4-fluorophenyl)butyl]piperazin-1-yl]pyridine-3-carboxylate?
The InChIKey is PPSFKXYTDFCKGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C34H35F2N3O2/c35-29-14-10-27(11-15-29)31(28-12-16-30(36)17-13-28)9-5-20-38-21-23-39(24-22-38)33-32(8-4-19-37-33)34(40)41-25-18-26-6-2-1-3-7-26/h1-4,6-8,10-17,19,31H,5,9,18,20-25H2.
What are the key properties of 2-phenylethyl 2-[4-[4,4-bis(4-fluorophenyl)butyl]piperazin-1-yl]pyridine-3-carboxylate?
2-phenylethyl 2-[4-[4,4-bis(4-fluorophenyl)butyl]piperazin-1-yl]pyridine-3-carboxylate has a molecular weight of 555.67 g/mol, XLogP of 6.49, 11 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenylethyl 2-[4-[4,4-bis(4-fluorophenyl)butyl]piperazin-1-yl]pyridine-3-carboxylate is sourced from PubChem (CID 22923300), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).