About 2-benzylsulfanylpyrazine
2-benzylsulfanylpyrazine (PubChem CID 22923306) has the molecular formula C11H10N2S
and a molecular weight of 202.28 g/mol. Its IUPAC name is 2-benzylsulfanylpyrazine.
Molecular Properties
| Compound Name | 2-benzylsulfanylpyrazine |
| PubChem CID | 22923306 |
| Molecular Formula | C11H10N2S |
| Molecular Weight | 202.28 g/mol |
| Exact Mass | 202.06 |
| IUPAC Name | 2-benzylsulfanylpyrazine |
| SMILES | c1ccc(CSc2cnccn2)cc1 |
| InChI | InChI=1S/C11H10N2S/c1-2-4-10(5-3-1)9-14-11-8-12-6-7-13-11/h1-8H,9H2 |
| InChIKey | HGSKLZKJIXMLDL-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.28 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-benzylsulfanylpyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzylsulfanylpyrazine?
The IUPAC name of 2-benzylsulfanylpyrazine (CID 22923306) is 2-benzylsulfanylpyrazine.
What is the SMILES notation for 2-benzylsulfanylpyrazine?
The canonical SMILES for 2-benzylsulfanylpyrazine is c1ccc(CSc2cnccn2)cc1.
What is the InChIKey of 2-benzylsulfanylpyrazine?
The InChIKey is HGSKLZKJIXMLDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N2S/c1-2-4-10(5-3-1)9-14-11-8-12-6-7-13-11/h1-8H,9H2.
What are the key properties of 2-benzylsulfanylpyrazine?
2-benzylsulfanylpyrazine has a molecular weight of 202.28 g/mol, XLogP of 2.77, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzylsulfanylpyrazine is sourced from PubChem (CID 22923306), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).