C27H30N6O6 — CID 22923465
3-[1-(6,7-dimethoxyquinazolin-4-yl)piperidin-4-yl]-1-(2-methylpropyl)-6-nitroquinazoline-2,4-dione (PubChem CID 22923465) has the molecular formula C27H30N6O6 and a molecular weight of 534.57 g/mol. Its IUPAC name is 3-[1-(6,7-dimethoxyquinazolin-4-yl)piperidin-4-yl]-1-(2-methylpropyl)-6-nitroquinazoline-2,4-dione.
| Compound Name | 3-[1-(6,7-dimethoxyquinazolin-4-yl)piperidin-4-yl]-1-(2-methylpropyl)-6-nitroquinazoline-2,4-dione |
|---|---|
| PubChem CID | 22923465 |
| Molecular Formula | C27H30N6O6 |
| Molecular Weight | 534.57 g/mol |
| Exact Mass | 534.22 |
| IUPAC Name | 3-[1-(6,7-dimethoxyquinazolin-4-yl)piperidin-4-yl]-1-(2-methylpropyl)-6-nitroquinazoline-2,4-dione |
| SMILES | COc1cc2ncnc(N3CCC(n4c(=O)c5cc([N+](=O)[O-])ccc5n(CC(C)C)c4=O)CC3)c2cc1OC |
| InChI | InChI=1S/C27H30N6O6/c1-16(2)14-31-22-6-5-18(33(36)37)11-20(22)26(34)32(27(31)35)17-7-9-30(10-8-17)25-19-12-23(38-3)24(39-4)13-21(19)28-15-29-25/h5-6,11-13,15-17H,7-10,14H2,1-4H3 |
| InChIKey | IYTIKDMVQGFCTG-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 134.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.57 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|