About 7-hydroxy-1-methyl-3-piperidin-4-ylquinazoline-2,4-dione;hydrobromide
7-hydroxy-1-methyl-3-piperidin-4-ylquinazoline-2,4-dione;hydrobromide (PubChem CID 22923480) has the molecular formula C14H18BrN3O3
and a molecular weight of 356.22 g/mol. Its IUPAC name is 7-hydroxy-1-methyl-3-piperidin-4-ylquinazoline-2,4-dione;hydrobromide.
Molecular Properties
| Compound Name | 7-hydroxy-1-methyl-3-piperidin-4-ylquinazoline-2,4-dione;hydrobromide |
| PubChem CID | 22923480 |
| Molecular Formula | C14H18BrN3O3 |
| Molecular Weight | 356.22 g/mol |
| Exact Mass | 355.05 |
| IUPAC Name | 7-hydroxy-1-methyl-3-piperidin-4-ylquinazoline-2,4-dione;hydrobromide |
| SMILES | Br.Cn1c(=O)n(C2CCNCC2)c(=O)c2ccc(O)cc21 |
| InChI | InChI=1S/C14H17N3O3.BrH/c1-16-12-8-10(18)2-3-11(12)13(19)17(14(16)20)9-4-6-15-7-5-9;/h2-3,8-9,15,18H,4-7H2,1H3;1H |
| InChIKey | BBAYYXSRLUKOKQ-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 76.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.22 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 7-hydroxy-1-methyl-3-piperidin-4-ylquinazoline-2,4-dione;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-hydroxy-1-methyl-3-piperidin-4-ylquinazoline-2,4-dione;hydrobromide?
The IUPAC name of 7-hydroxy-1-methyl-3-piperidin-4-ylquinazoline-2,4-dione;hydrobromide (CID 22923480) is 7-hydroxy-1-methyl-3-piperidin-4-ylquinazoline-2,4-dione;hydrobromide.
What is the SMILES notation for 7-hydroxy-1-methyl-3-piperidin-4-ylquinazoline-2,4-dione;hydrobromide?
The canonical SMILES for 7-hydroxy-1-methyl-3-piperidin-4-ylquinazoline-2,4-dione;hydrobromide is Br.Cn1c(=O)n(C2CCNCC2)c(=O)c2ccc(O)cc21.
What is the InChIKey of 7-hydroxy-1-methyl-3-piperidin-4-ylquinazoline-2,4-dione;hydrobromide?
The InChIKey is BBAYYXSRLUKOKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17N3O3.BrH/c1-16-12-8-10(18)2-3-11(12)13(19)17(14(16)20)9-4-6-15-7-5-9;/h2-3,8-9,15,18H,4-7H2,1H3;1H.
What are the key properties of 7-hydroxy-1-methyl-3-piperidin-4-ylquinazoline-2,4-dione;hydrobromide?
7-hydroxy-1-methyl-3-piperidin-4-ylquinazoline-2,4-dione;hydrobromide has a molecular weight of 356.22 g/mol, XLogP of 0.91, 1 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 7-hydroxy-1-methyl-3-piperidin-4-ylquinazoline-2,4-dione;hydrobromide is sourced from PubChem (CID 22923480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).