About 4-(2-methylpropyl)oxane
4-(2-methylpropyl)oxane (PubChem CID 22923698) has the molecular formula C9H18O
and a molecular weight of 142.24 g/mol. Its IUPAC name is 4-(2-methylpropyl)oxane.
Molecular Properties
| Compound Name | 4-(2-methylpropyl)oxane |
| PubChem CID | 22923698 |
| Molecular Formula | C9H18O |
| Molecular Weight | 142.24 g/mol |
| Exact Mass | 142.14 |
| IUPAC Name | 4-(2-methylpropyl)oxane |
| SMILES | CC(C)CC1CCOCC1 |
| InChI | InChI=1S/C9H18O/c1-8(2)7-9-3-5-10-6-4-9/h8-9H,3-7H2,1-2H3 |
| InChIKey | FDZXGTMQTJUINZ-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.24 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-(2-methylpropyl)oxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-methylpropyl)oxane?
The IUPAC name of 4-(2-methylpropyl)oxane (CID 22923698) is 4-(2-methylpropyl)oxane.
What is the SMILES notation for 4-(2-methylpropyl)oxane?
The canonical SMILES for 4-(2-methylpropyl)oxane is CC(C)CC1CCOCC1.
What is the InChIKey of 4-(2-methylpropyl)oxane?
The InChIKey is FDZXGTMQTJUINZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18O/c1-8(2)7-9-3-5-10-6-4-9/h8-9H,3-7H2,1-2H3.
What are the key properties of 4-(2-methylpropyl)oxane?
4-(2-methylpropyl)oxane has a molecular weight of 142.24 g/mol, XLogP of 2.46, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-methylpropyl)oxane is sourced from PubChem (CID 22923698), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).