C18H24ClN3O2 — CID 22924322
6-amino-1-[8-(chloromethyl)-4-hydroxy-1-methyl-7,8-dihydro-3H-pyrrolo[3,2-e]indol-6-yl]hexan-1-one (PubChem CID 22924322) has the molecular formula C18H24ClN3O2 and a molecular weight of 349.86 g/mol. Its IUPAC name is 6-amino-1-[8-(chloromethyl)-4-hydroxy-1-methyl-7,8-dihydro-3H-pyrrolo[3,2-e]indol-6-yl]hexan-1-one.
| Compound Name | 6-amino-1-[8-(chloromethyl)-4-hydroxy-1-methyl-7,8-dihydro-3H-pyrrolo[3,2-e]indol-6-yl]hexan-1-one |
|---|---|
| PubChem CID | 22924322 |
| Molecular Formula | C18H24ClN3O2 |
| Molecular Weight | 349.86 g/mol |
| Exact Mass | 349.16 |
| IUPAC Name | 6-amino-1-[8-(chloromethyl)-4-hydroxy-1-methyl-7,8-dihydro-3H-pyrrolo[3,2-e]indol-6-yl]hexan-1-one |
| SMILES | Cc1c[nH]c2c(O)cc3c(c12)C(CCl)CN3C(=O)CCCCCN |
| InChI | InChI=1S/C18H24ClN3O2/c1-11-9-21-18-14(23)7-13-17(16(11)18)12(8-19)10-22(13)15(24)5-3-2-4-6-20/h7,9,12,21,23H,2-6,8,10,20H2,1H3 |
| InChIKey | HZAFDEMXCBJYRJ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 82.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.86 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|