About N-[(2-ethylcyclopenta-1,3-dien-1-yl)-dimethylsilyl]formamide
N-[(2-ethylcyclopenta-1,3-dien-1-yl)-dimethylsilyl]formamide (PubChem CID 22924499) has the molecular formula C10H17NOSi
and a molecular weight of 195.34 g/mol. Its IUPAC name is N-[(2-ethylcyclopenta-1,3-dien-1-yl)-dimethylsilyl]formamide.
Molecular Properties
| Compound Name | N-[(2-ethylcyclopenta-1,3-dien-1-yl)-dimethylsilyl]formamide |
| PubChem CID | 22924499 |
| Molecular Formula | C10H17NOSi |
| Molecular Weight | 195.34 g/mol |
| Exact Mass | 195.11 |
| IUPAC Name | N-[(2-ethylcyclopenta-1,3-dien-1-yl)-dimethylsilyl]formamide |
| SMILES | CCC1=C([Si](C)(C)NC=O)CC=C1 |
| InChI | InChI=1S/C10H17NOSi/c1-4-9-6-5-7-10(9)13(2,3)11-8-12/h5-6,8H,4,7H2,1-3H3,(H,11,12) |
| InChIKey | PKFCJKMYZLWSPC-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.34 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze N-[(2-ethylcyclopenta-1,3-dien-1-yl)-dimethylsilyl]formamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2-ethylcyclopenta-1,3-dien-1-yl)-dimethylsilyl]formamide?
The IUPAC name of N-[(2-ethylcyclopenta-1,3-dien-1-yl)-dimethylsilyl]formamide (CID 22924499) is N-[(2-ethylcyclopenta-1,3-dien-1-yl)-dimethylsilyl]formamide.
What is the SMILES notation for N-[(2-ethylcyclopenta-1,3-dien-1-yl)-dimethylsilyl]formamide?
The canonical SMILES for N-[(2-ethylcyclopenta-1,3-dien-1-yl)-dimethylsilyl]formamide is CCC1=C([Si](C)(C)NC=O)CC=C1.
What is the InChIKey of N-[(2-ethylcyclopenta-1,3-dien-1-yl)-dimethylsilyl]formamide?
The InChIKey is PKFCJKMYZLWSPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NOSi/c1-4-9-6-5-7-10(9)13(2,3)11-8-12/h5-6,8H,4,7H2,1-3H3,(H,11,12).
What are the key properties of N-[(2-ethylcyclopenta-1,3-dien-1-yl)-dimethylsilyl]formamide?
N-[(2-ethylcyclopenta-1,3-dien-1-yl)-dimethylsilyl]formamide has a molecular weight of 195.34 g/mol, XLogP of 2.14, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2-ethylcyclopenta-1,3-dien-1-yl)-dimethylsilyl]formamide is sourced from PubChem (CID 22924499), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).