About (1-oxo-1,4-thiazinan-4-yl)methanol
(1-oxo-1,4-thiazinan-4-yl)methanol (PubChem CID 22924645) has the molecular formula C5H11NO2S
and a molecular weight of 149.21 g/mol. Its IUPAC name is (1-oxo-1,4-thiazinan-4-yl)methanol.
Molecular Properties
| Compound Name | (1-oxo-1,4-thiazinan-4-yl)methanol |
| PubChem CID | 22924645 |
| Molecular Formula | C5H11NO2S |
| Molecular Weight | 149.21 g/mol |
| Exact Mass | 149.05 |
| IUPAC Name | (1-oxo-1,4-thiazinan-4-yl)methanol |
| SMILES | O=S1CCN(CO)CC1 |
| InChI | InChI=1S/C5H11NO2S/c7-5-6-1-3-9(8)4-2-6/h7H,1-5H2 |
| InChIKey | BMVKPPFSFPEURG-UHFFFAOYSA-N |
| XLogP | -1.00 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.21 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (1-oxo-1,4-thiazinan-4-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-oxo-1,4-thiazinan-4-yl)methanol?
The IUPAC name of (1-oxo-1,4-thiazinan-4-yl)methanol (CID 22924645) is (1-oxo-1,4-thiazinan-4-yl)methanol.
What is the SMILES notation for (1-oxo-1,4-thiazinan-4-yl)methanol?
The canonical SMILES for (1-oxo-1,4-thiazinan-4-yl)methanol is O=S1CCN(CO)CC1.
What is the InChIKey of (1-oxo-1,4-thiazinan-4-yl)methanol?
The InChIKey is BMVKPPFSFPEURG-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11NO2S/c7-5-6-1-3-9(8)4-2-6/h7H,1-5H2.
What are the key properties of (1-oxo-1,4-thiazinan-4-yl)methanol?
(1-oxo-1,4-thiazinan-4-yl)methanol has a molecular weight of 149.21 g/mol, XLogP of -1.00, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1-oxo-1,4-thiazinan-4-yl)methanol is sourced from PubChem (CID 22924645), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).