C11H12F4O3Si — CID 22924815
(4-ethenyl-2,3,5,6-tetrafluorophenyl)-trimethoxysilane (PubChem CID 22924815) has the molecular formula C11H12F4O3Si and a molecular weight of 296.29 g/mol. Its IUPAC name is (4-ethenyl-2,3,5,6-tetrafluorophenyl)-trimethoxysilane.
| Compound Name | (4-ethenyl-2,3,5,6-tetrafluorophenyl)-trimethoxysilane |
|---|---|
| PubChem CID | 22924815 |
| Molecular Formula | C11H12F4O3Si |
| Molecular Weight | 296.29 g/mol |
| Exact Mass | 296.05 |
| IUPAC Name | (4-ethenyl-2,3,5,6-tetrafluorophenyl)-trimethoxysilane |
| SMILES | C=Cc1c(F)c(F)c([Si](OC)(OC)OC)c(F)c1F |
| InChI | InChI=1S/C11H12F4O3Si/c1-5-6-7(12)9(14)11(10(15)8(6)13)19(16-2,17-3)18-4/h5H,1H2,2-4H3 |
| InChIKey | BLNUWYASRJTEMW-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.29 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|