C20H13F17O2 — CID 22924878
2,3-dihydro-1H-inden-1-yl 4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoroundecanoate (PubChem CID 22924878) has the molecular formula C20H13F17O2 and a molecular weight of 608.29 g/mol. Its IUPAC name is 2,3-dihydro-1H-inden-1-yl 4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoroundecanoate.
| Compound Name | 2,3-dihydro-1H-inden-1-yl 4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoroundecanoate |
|---|---|
| PubChem CID | 22924878 |
| Molecular Formula | C20H13F17O2 |
| Molecular Weight | 608.29 g/mol |
| Exact Mass | 608.06 |
| IUPAC Name | 2,3-dihydro-1H-inden-1-yl 4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoroundecanoate |
| SMILES | O=C(CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)OC1CCc2ccccc21 |
| InChI | InChI=1S/C20H13F17O2/c21-13(22,8-7-12(38)39-11-6-5-9-3-1-2-4-10(9)11)14(23,24)15(25,26)16(27,28)17(29,30)18(31,32)19(33,34)20(35,36)37/h1-4,11H,5-8H2 |
| InChIKey | DUVCQIVPUVMEJP-UHFFFAOYSA-N |
| XLogP | 8.01 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.29 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|