About 2-[2-(1,3-oxazolidin-2-yl)phenyl]-1,3-oxazolidine
2-[2-(1,3-oxazolidin-2-yl)phenyl]-1,3-oxazolidine (PubChem CID 22924918) has the molecular formula C12H16N2O2
and a molecular weight of 220.27 g/mol. Its IUPAC name is 2-[2-(1,3-oxazolidin-2-yl)phenyl]-1,3-oxazolidine.
Molecular Properties
| Compound Name | 2-[2-(1,3-oxazolidin-2-yl)phenyl]-1,3-oxazolidine |
| PubChem CID | 22924918 |
| Molecular Formula | C12H16N2O2 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | 2-[2-(1,3-oxazolidin-2-yl)phenyl]-1,3-oxazolidine |
| SMILES | c1ccc(C2NCCO2)c(C2NCCO2)c1 |
| InChI | InChI=1S/C12H16N2O2/c1-2-4-10(12-14-6-8-16-12)9(3-1)11-13-5-7-15-11/h1-4,11-14H,5-8H2 |
| InChIKey | NEMBYWMNBZDLPU-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[2-(1,3-oxazolidin-2-yl)phenyl]-1,3-oxazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(1,3-oxazolidin-2-yl)phenyl]-1,3-oxazolidine?
The IUPAC name of 2-[2-(1,3-oxazolidin-2-yl)phenyl]-1,3-oxazolidine (CID 22924918) is 2-[2-(1,3-oxazolidin-2-yl)phenyl]-1,3-oxazolidine.
What is the SMILES notation for 2-[2-(1,3-oxazolidin-2-yl)phenyl]-1,3-oxazolidine?
The canonical SMILES for 2-[2-(1,3-oxazolidin-2-yl)phenyl]-1,3-oxazolidine is c1ccc(C2NCCO2)c(C2NCCO2)c1.
What is the InChIKey of 2-[2-(1,3-oxazolidin-2-yl)phenyl]-1,3-oxazolidine?
The InChIKey is NEMBYWMNBZDLPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N2O2/c1-2-4-10(12-14-6-8-16-12)9(3-1)11-13-5-7-15-11/h1-4,11-14H,5-8H2.
What are the key properties of 2-[2-(1,3-oxazolidin-2-yl)phenyl]-1,3-oxazolidine?
2-[2-(1,3-oxazolidin-2-yl)phenyl]-1,3-oxazolidine has a molecular weight of 220.27 g/mol, XLogP of 0.92, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(1,3-oxazolidin-2-yl)phenyl]-1,3-oxazolidine is sourced from PubChem (CID 22924918), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).