About methyl 3-(1,3-oxazol-2-yl)-3-oxopropanoate
methyl 3-(1,3-oxazol-2-yl)-3-oxopropanoate (PubChem CID 22925179) has the molecular formula C7H7NO4
and a molecular weight of 169.14 g/mol. Its IUPAC name is methyl 3-(1,3-oxazol-2-yl)-3-oxopropanoate.
Molecular Properties
| Compound Name | methyl 3-(1,3-oxazol-2-yl)-3-oxopropanoate |
| PubChem CID | 22925179 |
| Molecular Formula | C7H7NO4 |
| Molecular Weight | 169.14 g/mol |
| Exact Mass | 169.04 |
| IUPAC Name | methyl 3-(1,3-oxazol-2-yl)-3-oxopropanoate |
| SMILES | COC(=O)CC(=O)c1ncco1 |
| InChI | InChI=1S/C7H7NO4/c1-11-6(10)4-5(9)7-8-2-3-12-7/h2-3H,4H2,1H3 |
| InChIKey | BGHUUDYMIDJYHI-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 69.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.14 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-(1,3-oxazol-2-yl)-3-oxopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-(1,3-oxazol-2-yl)-3-oxopropanoate?
The IUPAC name of methyl 3-(1,3-oxazol-2-yl)-3-oxopropanoate (CID 22925179) is methyl 3-(1,3-oxazol-2-yl)-3-oxopropanoate.
What is the SMILES notation for methyl 3-(1,3-oxazol-2-yl)-3-oxopropanoate?
The canonical SMILES for methyl 3-(1,3-oxazol-2-yl)-3-oxopropanoate is COC(=O)CC(=O)c1ncco1.
What is the InChIKey of methyl 3-(1,3-oxazol-2-yl)-3-oxopropanoate?
The InChIKey is BGHUUDYMIDJYHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO4/c1-11-6(10)4-5(9)7-8-2-3-12-7/h2-3H,4H2,1H3.
What are the key properties of methyl 3-(1,3-oxazol-2-yl)-3-oxopropanoate?
methyl 3-(1,3-oxazol-2-yl)-3-oxopropanoate has a molecular weight of 169.14 g/mol, XLogP of 0.42, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(1,3-oxazol-2-yl)-3-oxopropanoate is sourced from PubChem (CID 22925179), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).